[(2S,3R,4R,5R,6S)-5-acetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-hydroxyoxan-2-yl]methoxy]-4-hydroxy-2-methyloxan-3-yl] acetate
Internal ID | c2b635ad-78d2-4790-a78e-1e873c00dcb7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-hydroxyoxan-2-yl]methoxy]-4-hydroxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)OC(=O)C)OC(=O)C)OC(=O)C)O)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)OC(=O)C)OC(=O)C)OC(=O)C)O)OC(=O)C |
InChI | InChI=1S/C35H38O20/c1-12-28(49-13(2)36)26(45)33(52-16(5)39)35(48-12)47-11-23-30(50-14(3)37)32(51-15(4)38)27(46)34(54-23)55-31-25(44)24-21(43)9-18(40)10-22(24)53-29(31)17-6-7-19(41)20(42)8-17/h6-10,12,23,26-28,30,32-35,40-43,45-46H,11H2,1-5H3/t12-,23+,26+,27+,28-,30-,32+,33+,34-,35-/m0/s1 |
InChI Key | FSJGQFHHFGJQNB-VGVGNWBGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H38O20 |
Molecular Weight | 778.70 g/mol |
Exact Mass | 778.19564360 g/mol |
Topological Polar Surface Area (TPSA) | 290.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-hydroxyoxan-2-yl]methoxy]-4-hydroxy-2-methyloxan-3-yl] acetate 2D Structure of [(2S,3R,4R,5R,6S)-5-acetyloxy-6-[[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-hydroxyoxan-2-yl]methoxy]-4-hydroxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/d2fb4430-873a-11ee-9084-1b6a4a26d782.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.28% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.23% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.53% | 95.64% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.34% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.74% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.23% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.85% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.67% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.70% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.59% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.00% | 94.42% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.85% | 80.78% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.83% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.46% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.26% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.21% | 95.78% |
CHEMBL3194 | P02766 | Transthyretin | 83.25% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.53% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schenkia spicata |
PubChem | 162965053 |
LOTUS | LTS0191465 |
wikiData | Q105000665 |