6,18-Dihydroxy-11-methoxy-6-methyl-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1,9,11,14(19),15,17-hexaen-13-one
| Internal ID | 3c545b86-acc5-4222-b163-4ba743f87723 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 6,18-dihydroxy-11-methoxy-6-methyl-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1,9,11,14(19),15,17-hexaen-13-one |
| SMILES (Canonical) | CC1(COC2C1OC3=CC(=C4C(=C23)OC5=C(C4=O)C=CC=C5O)OC)O |
| SMILES (Isomeric) | CC1(COC2C1OC3=CC(=C4C(=C23)OC5=C(C4=O)C=CC=C5O)OC)O |
| InChI | InChI=1S/C19H16O7/c1-19(22)7-24-17-13-11(25-18(17)19)6-10(23-2)12-14(21)8-4-3-5-9(20)15(8)26-16(12)13/h3-6,17-18,20,22H,7H2,1-2H3 |
| InChI Key | ZDHCSGNLOGAREA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.08960285 g/mol |
| Topological Polar Surface Area (TPSA) | 94.50 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of 6,18-Dihydroxy-11-methoxy-6-methyl-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1,9,11,14(19),15,17-hexaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/d29f5ac0-86e2-11ee-886a-af9ed1715b88.jpg "2D Structure of 6,18-Dihydroxy-11-methoxy-6-methyl-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1,9,11,14(19),15,17-hexaen-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.55% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.33% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.11% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.71% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.34% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.31% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.30% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.74% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.08% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.92% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.31% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.78% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.33% | 97.14% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.56% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.63% | 96.09% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 84.43% | 82.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.18% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.21% | 97.09% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.03% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Psorospermum febrifugum |
| PubChem | 14352928 |
| LOTUS | LTS0241387 |
| wikiData | Q105372190 |