[(1S,5S,8R,10R,13S)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate
Internal ID | 4da9e97b-9551-4951-887f-772139a535f1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | [(1S,5S,8R,10R,13S)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
SMILES (Canonical) | CCN1CC2(CCC(C34C2C(C(C31)C5(CC(C6(CC4C5C6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)OC)COC |
SMILES (Isomeric) | CCN1C[C@@]2(CCC([C@]34[C@H]1C(C(C23)OC)[C@]5(CC([C@]6(CC4C5C6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)COC |
InChI | InChI=1S/C35H49NO10/c1-8-36-17-32(18-40-3)14-13-23(42-5)35-22-15-33(39)24(43-6)16-34(46-19(2)37,26(29(35)36)27(44-7)28(32)35)25(22)30(33)45-31(38)20-9-11-21(41-4)12-10-20/h9-12,22-30,39H,8,13-18H2,1-7H3/t22?,23?,24?,25?,26?,27?,28?,29-,30?,32+,33+,34-,35+/m1/s1 |
InChI Key | GAZDXIGXYWVWQX-MRRNIPHUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H49NO10 |
Molecular Weight | 643.80 g/mol |
Exact Mass | 643.33564676 g/mol |
Topological Polar Surface Area (TPSA) | 122.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of [(1S,5S,8R,10R,13S)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate 2D Structure of [(1S,5S,8R,10R,13S)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/d26e9da0-8558-11ee-941b-b99b79384228.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.57% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.79% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.13% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.67% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.59% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.32% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.92% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.08% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.05% | 93.99% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.72% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.97% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.76% | 92.94% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 87.70% | 81.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.43% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.55% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.87% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.28% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.75% | 99.23% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.23% | 97.28% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 81.58% | 94.97% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.46% | 96.47% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.83% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum carmichaelii |
Aconitum dolichorhynchum |
Aconitum ferox |
Aconitum forrestii |
Aconitum geniculatum |
Aconitum hemsleyanum |
Aconitum transsectum |
PubChem | 145994473 |
LOTUS | LTS0189899 |
wikiData | Q105114634 |