d-Bulbocapnine
| Internal ID | c18c21c8-d173-4e32-9c45-009b299d24e1 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 17-methoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-18-ol |
| SMILES (Canonical) | CN1CCC2=CC3=C(C4=C2C1CC5=C4C(=C(C=C5)OC)O)OCO3 |
| SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C2C1CC5=C4C(=C(C=C5)OC)O)OCO3 |
| InChI | InChI=1S/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(22-2)18(21)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3 |
| InChI Key | LODGIKWNLDQZBM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 2.90 |
| 5H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinolin-12-ol, 6,7,7a,8-tetrahydro-11-methoxy-7-methyl- |
| Bulbokapnin |
| 72002-80-3 |
| Oprea1_003816 |
| SCHEMBL11253583 |
| ACon1_002350 |
| DTXSID50871626 |
| LODGIKWNLDQZBM-UHFFFAOYSA-N |
| NCGC00169929-01 |
| BRD-A35379089-001-01-6 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.98% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.98% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.78% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.42% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.13% | 95.56% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.01% | 91.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.74% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.28% | 95.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.02% | 95.89% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.30% | 95.78% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.14% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.68% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.64% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.32% | 93.40% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.62% | 90.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.96% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.93% | 94.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.47% | 82.67% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.22% | 88.48% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.95% | 93.99% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.23% | 82.38% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 85.98% | 96.86% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.67% | 90.95% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.28% | 89.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.22% | 95.89% |
| CHEMBL240 | Q12809 | HERG | 84.19% | 89.76% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.86% | 85.14% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.82% | 96.76% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.75% | 89.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.71% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 9276 |
| LOTUS | LTS0222152 |
| wikiData | Q105154650 |