Cyclo(Phe-Leu)
| Internal ID | c5fb93b1-8c0c-499d-9d4e-5d013b188b27 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 3-benzyl-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)N1)CC2=CC=CC=C2 |
| SMILES (Isomeric) | CC(C)CC1C(=O)NC(C(=O)N1)CC2=CC=CC=C2 |
| InChI | InChI=1S/C15H20N2O2/c1-10(2)8-12-14(18)17-13(15(19)16-12)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChI Key | QPDMOMIYLJMOQJ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 58.20 Ų |
| XlogP | 2.40 |
| 3354-31-2 |
| 3-benzyl-6-(2-methylpropyl)piperazine-2,5-dione |
| 3-benzyl-6-isobutylpiperazine-2,5-dione |
| SCHEMBL3124456 |
| AKOS014213066 |
| FS-6943 |
| 3-benzyl-6-isobutylpiper-azine-2,5-dione |
| FT-0777789 |
| 3-benzyl-6-(2-methylpropyl)-2,5-piperazinedione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.05% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.63% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.36% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.95% | 83.82% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.86% | 97.64% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.08% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.47% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.08% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.06% | 95.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.79% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.58% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coffea arabica |
| Portulaca oleracea |
| PubChem | 562691 |
| LOTUS | LTS0253263 |
| wikiData | Q105225327 |