cyclo[Gly-Ile-Leu-Gly-Ser-Pro-Ile-Leu-Leu]
| Internal ID | 95ca7c21-a4e8-4b2a-840a-d15cf84b2956 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (3S,9S,12S,18S,21S,24S,27S)-12,24-bis[(2S)-butan-2-yl]-3-(hydroxymethyl)-9,18,21-tris(2-methylpropyl)-1,4,7,10,13,16,19,22,25-nonazabicyclo[25.3.0]triacontane-2,5,8,11,14,17,20,23,26-nonone |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NCC(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)N1)CC(C)C)CC(C)C)C(C)CC)CO)CC(C)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N1)CC(C)C)CC(C)C)[C@@H](C)CC)CO)CC(C)C |
| InChI | InChI=1S/C42H73N9O10/c1-11-25(9)34-40(59)47-28(17-23(5)6)37(56)43-19-32(53)45-30(21-52)42(61)51-15-13-14-31(51)39(58)50-35(26(10)12-2)41(60)48-29(18-24(7)8)38(57)46-27(16-22(3)4)36(55)44-20-33(54)49-34/h22-31,34-35,52H,11-21H2,1-10H3,(H,43,56)(H,44,55)(H,45,53)(H,46,57)(H,47,59)(H,48,60)(H,49,54)(H,50,58)/t25-,26-,27-,28-,29-,30-,31-,34-,35-/m0/s1 |
| InChI Key | IWKWVRMBZLGYAK-WAJLRALXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H73N9O10 |
| Molecular Weight | 864.10 g/mol |
| Exact Mass | 863.54803956 g/mol |
| Topological Polar Surface Area (TPSA) | 273.00 Ų |
| XlogP | 3.30 |
| Atomic LogP (AlogP) | -0.64 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
![2D Structure of cyclo[Gly-Ile-Leu-Gly-Ser-Pro-Ile-Leu-Leu]](https://plantaedb.com/storage/docs/compounds/2023/11/cyclogly-ile-leu-gly-ser-pro-ile-leu-leu.jpg "2D Structure of cyclo[Gly-Ile-Leu-Gly-Ser-Pro-Ile-Leu-Leu]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8913 | 89.13% |
| Caco-2 | - | 0.8571 | 85.71% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | + | 0.5143 | 51.43% |
| Subcellular localzation | Mitochondria | 0.5144 | 51.44% |
| OATP2B1 inhibitior | - | 0.7155 | 71.55% |
| OATP1B1 inhibitior | + | 0.8654 | 86.54% |
| OATP1B3 inhibitior | + | 0.9252 | 92.52% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.8255 | 82.55% |
| P-glycoprotein inhibitior | + | 0.7363 | 73.63% |
| P-glycoprotein substrate | + | 0.8019 | 80.19% |
| CYP3A4 substrate | + | 0.5884 | 58.84% |
| CYP2C9 substrate | - | 0.8000 | 80.00% |
| CYP2D6 substrate | - | 0.8324 | 83.24% |
| CYP3A4 inhibition | - | 0.9734 | 97.34% |
| CYP2C9 inhibition | - | 0.9509 | 95.09% |
| CYP2C19 inhibition | - | 0.9533 | 95.33% |
| CYP2D6 inhibition | - | 0.9358 | 93.58% |
| CYP1A2 inhibition | - | 0.9596 | 95.96% |
| CYP2C8 inhibition | - | 0.7961 | 79.61% |
| CYP inhibitory promiscuity | - | 0.9960 | 99.60% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.6097 | 60.97% |
| Eye corrosion | - | 0.9852 | 98.52% |
| Eye irritation | - | 0.9002 | 90.02% |
| Skin irritation | - | 0.7772 | 77.72% |
| Skin corrosion | - | 0.9201 | 92.01% |
| Ames mutagenesis | - | 0.7554 | 75.54% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4276 | 42.76% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8989 | 89.89% |
| Respiratory toxicity | + | 0.6111 | 61.11% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.7284 | 72.84% |
| Acute Oral Toxicity (c) | III | 0.6183 | 61.83% |
| Estrogen receptor binding | + | 0.7932 | 79.32% |
| Androgen receptor binding | + | 0.6203 | 62.03% |
| Thyroid receptor binding | + | 0.5219 | 52.19% |
| Glucocorticoid receptor binding | + | 0.5505 | 55.05% |
| Aromatase binding | + | 0.6529 | 65.29% |
| PPAR gamma | + | 0.7088 | 70.88% |
| Honey bee toxicity | - | 0.8696 | 86.96% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.7600 | 76.00% |
| Fish aquatic toxicity | - | 0.5893 | 58.93% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.46% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.13% | 97.25% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 97.08% | 92.97% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.13% | 90.08% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.36% | 96.31% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 94.04% | 94.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.80% | 82.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.72% | 97.09% |
| CHEMBL4071 | P08311 | Cathepsin G | 90.62% | 94.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.23% | 94.66% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.48% | 97.05% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.25% | 91.03% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.96% | 97.64% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.74% | 96.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.52% | 95.50% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 87.49% | 99.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.47% | 95.93% |
| CHEMBL1801 | P00747 | Plasminogen | 87.33% | 92.44% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.17% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.11% | 90.71% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.71% | 99.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.39% | 95.89% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 85.42% | 94.36% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.24% | 94.75% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 85.22% | 97.50% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.07% | 90.93% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 85.06% | 96.69% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.82% | 88.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.66% | 100.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.27% | 95.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.93% | 96.90% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.86% | 90.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.83% | 93.00% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.46% | 90.24% |
| CHEMBL228 | P31645 | Serotonin transporter | 83.27% | 95.51% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 83.00% | 92.12% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.68% | 97.14% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 82.22% | 92.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.95% | 85.14% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.59% | 93.04% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.53% | 93.03% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.25% | 96.38% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.24% | 91.11% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.12% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Jatropha curcas |
| PubChem | 101702231 |
| LOTUS | LTS0136460 |
| wikiData | Q105121708 |