cyclo[Ala-Tyr-Asn-Phe-Gly-Leu]
| Internal ID | 34db16e3-5167-48a2-baba-bbb865c244f5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[(2S,5S,11S,14S,17S)-5-benzyl-17-[(4-hydroxyphenyl)methyl]-14-methyl-11-(2-methylpropyl)-3,6,9,12,15,18-hexaoxo-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetamide |
| SMILES (Canonical) | CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)N1)CC(C)C)CC2=CC=CC=C2)CC(=O)N)CC3=CC=C(C=C3)O |
| SMILES (Isomeric) | C[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N1)CC(C)C)CC2=CC=CC=C2)CC(=O)N)CC3=CC=C(C=C3)O |
| InChI | InChI=1S/C33H43N7O8/c1-18(2)13-23-31(46)36-19(3)29(44)38-25(15-21-9-11-22(41)12-10-21)32(47)40-26(16-27(34)42)33(48)39-24(14-20-7-5-4-6-8-20)30(45)35-17-28(43)37-23/h4-12,18-19,23-26,41H,13-17H2,1-3H3,(H2,34,42)(H,35,45)(H,36,46)(H,37,43)(H,38,44)(H,39,48)(H,40,47)/t19-,23-,24-,25-,26-/m0/s1 |
| InChI Key | WBVXMGDUMBMSJF-YPOOPGCJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C33H43N7O8 |
| Molecular Weight | 665.70 g/mol |
| Exact Mass | 665.31731136 g/mol |
| Topological Polar Surface Area (TPSA) | 238.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.51% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.67% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.87% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.75% | 95.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.33% | 93.10% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.26% | 93.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.56% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.17% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.72% | 85.14% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.53% | 97.64% |
| CHEMBL4071 | P08311 | Cathepsin G | 86.82% | 94.64% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.61% | 90.93% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.07% | 98.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.86% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.02% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.60% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.22% | 97.25% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 82.48% | 92.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.31% | 91.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.08% | 90.08% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.95% | 97.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.54% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.94% | 99.17% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.94% | 97.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.33% | 90.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.25% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dianthus superbus |
| PubChem | 100927169 |
| LOTUS | LTS0126943 |
| wikiData | Q105301106 |