Cucurbitaxanthin A
Internal ID | 2bbab60a-7e2f-4b91-8117-55301a1b95cb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | (1R,2R,4S)-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |
SMILES (Canonical) | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC23C(CC(O2)CC3(C)O)(C)C)C)C |
SMILES (Isomeric) | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@@]23[C@](C[C@@H](O2)CC3(C)C)(C)O)/C)/C |
InChI | InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40-38(8,9)27-35(43-40)28-39(40,10)42/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t34-,35+,39-,40-/m1/s1 |
InChI Key | LMIFPRVTIOZTJN-SZYTUFQFSA-N |
Popularity | 16 references in papers |
Molecular Formula | C40H56O3 |
Molecular Weight | 584.90 g/mol |
Exact Mass | 584.42294564 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 10.30 |
103955-77-7 |
(1R,2R,4S)-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-Hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |
CHEBI:192915 |
DTXSID401315840 |
Q63409473 |
(1R,2R,4S)-1-((1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-((R)-4-Hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl)-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-2-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.95% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.68% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.04% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.52% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.47% | 86.33% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 86.73% | 95.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.92% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.55% | 94.73% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 85.47% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.35% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.33% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.48% | 92.94% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.88% | 92.97% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.78% | 91.71% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 82.20% | 91.67% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.05% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Cucurbita maxima |
PubChem | 11433225 |
LOTUS | LTS0063142 |
wikiData | Q63409473 |