Crotonosine
Internal ID | af52b5b5-dd7e-4b6a-864b-9f58881e78a0 |
Taxonomy | Alkaloids and derivatives > Proaporphines |
IUPAC Name | (4R)-10-hydroxy-11-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,4'-cyclohexa-2,5-diene]-1'-one |
SMILES (Canonical) | COC1=C(C=C2CCNC3C2=C1C4(C3)C=CC(=O)C=C4)O |
SMILES (Isomeric) | COC1=C(C=C2CCN[C@H]3C2=C1C4(C3)C=CC(=O)C=C4)O |
InChI | InChI=1S/C17H17NO3/c1-21-16-13(20)8-10-4-7-18-12-9-17(15(16)14(10)12)5-2-11(19)3-6-17/h2-3,5-6,8,12,18,20H,4,7,9H2,1H3/t12-/m1/s1 |
InChI Key | BYJAWHGHAOZTGW-GFCCVEGCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H17NO3 |
Molecular Weight | 283.32 g/mol |
Exact Mass | 283.12084340 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 1.70 |
2241-43-2 |
Spiro[2,5-cyclohexadiene-1,7'(1'H)-cyclopent[ij]isoquinolin]-4-one, 2',3',8',8'a-tetrahydro-5'-hydroxy-6'-methoxy-, (R)- |
BYJAWHGHAOZTGW-GFCCVEGCSA-N |
(4R)-10-hydroxy-11-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,4'-cyclohexa-2,5-diene]-1'-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.68% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.12% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.21% | 91.49% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.04% | 94.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.51% | 85.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.40% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.35% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.86% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.39% | 98.75% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.03% | 91.03% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.76% | 93.40% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.72% | 92.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.31% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.78% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.69% | 100.00% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.41% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.25% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.40% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.95% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.80% | 92.62% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.57% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 81.57% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.97% | 95.50% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.61% | 93.03% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.45% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Croton linearis |
Croton vaillantii |
Magnolia liliiflora |
Uvaria klaineana |
PubChem | 12304151 |
NPASS | NPC136190 |
LOTUS | LTS0107076 |
wikiData | Q104949394 |