Coumurrayin
Internal ID | a3d36555-3a0f-478f-8ea2-a2f4f64f95e0 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one |
SMILES (Canonical) | CC(=CCC1=C(C=C(C2=C1OC(=O)C=C2)OC)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C=C(C2=C1OC(=O)C=C2)OC)OC)C |
InChI | InChI=1S/C16H18O4/c1-10(2)5-6-11-13(18-3)9-14(19-4)12-7-8-15(17)20-16(11)12/h5,7-9H,6H2,1-4H3 |
InChI Key | CPXPWRXPEOMRNV-UHFFFAOYSA-N |
Popularity | 21 references in papers |
Molecular Formula | C16H18O4 |
Molecular Weight | 274.31 g/mol |
Exact Mass | 274.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 3.80 |
17245-25-9 |
5,7-dimethoxy-8-(3-methylbut-2-enyl)chromen-2-one |
CHEMBL3235998 |
2H-1-Benzopyran-2-one, 5,7-dimethoxy-8-(3-methyl-2-butenyl)- ; Coumarin, 5,7-dimethoxy-8-(3-methyl-2-butenyl)- |
SCHEMBL16341040 |
DTXSID30938160 |
BDBM50008742 |
AKOS032948534 |
Coumarin, 5,7-dimethoxy-8-(3-methyl-2-butenyl)- |
5,7-Dimethoxy-8-(3-methylbut-2-en-1-yl)-2H-1-benzopyran-2-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL288 | Q08499 | Phosphodiesterase 4D |
6820 nM |
IC50 |
PMID: 24597921
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.90% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.07% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.54% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.95% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.32% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.44% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.43% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.92% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.39% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.57% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.36% | 97.21% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.29% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 81.06% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica pubescens |
Angelica ursina |
Hortia longifolia |
Murraya alata |
Murraya paniculata |
Murraya paniculata |
Peucedanum rubricaule |
Seseli sibiricum |
Toddalia asiatica |
PubChem | 176911 |
NPASS | NPC73413 |
ChEMBL | CHEMBL3235998 |
LOTUS | LTS0122057 |
wikiData | Q72461643 |