Corynantheidol
Internal ID | ad47a158-b87b-4db7-8cc9-5613032c2b68 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
IUPAC Name | 2-[(2R,3S,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]ethanol |
SMILES (Canonical) | CCC1CN2CCC3=C(C2CC1CCO)NC4=CC=CC=C34 |
SMILES (Isomeric) | CC[C@@H]1CN2CCC3=C([C@@H]2C[C@@H]1CCO)NC4=CC=CC=C34 |
InChI | InChI=1S/C19H26N2O/c1-2-13-12-21-9-7-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14(13)8-10-22/h3-6,13-14,18,20,22H,2,7-12H2,1H3/t13-,14+,18+/m1/s1 |
InChI Key | KBMIVGVAJKVWBU-GLJUWKHASA-N |
Popularity | 5 references in papers |
Molecular Formula | C19H26N2O |
Molecular Weight | 298.40 g/mol |
Exact Mass | 298.204513457 g/mol |
Topological Polar Surface Area (TPSA) | 39.30 Ų |
XlogP | 3.20 |
483-27-2 |
Corynan-17-ol, (20beta)- |
2-[(2R,3S,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]ethanol |
CHEBI:141890 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.86% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.70% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.34% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.70% | 98.95% |
CHEMBL240 | Q12809 | HERG | 88.21% | 89.76% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.02% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.94% | 97.25% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.00% | 93.99% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.51% | 87.45% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.48% | 90.71% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.31% | 88.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.18% | 91.71% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.66% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mitragyna parvifolia |
PubChem | 11044739 |
LOTUS | LTS0224850 |
wikiData | Q105138350 |