Conophyllidine
Internal ID | 6481b5a6-8322-44c4-8a30-bdcd868b3f41 |
Taxonomy | Alkaloids and derivatives > Aspidospermatan-type alkaloids |
IUPAC Name | dimethyl (2S,6R,13S,22R,23R,24R,35R,38S,39R)-13,24-diethyl-23,32-dihydroxy-30,31-dimethoxy-21-oxa-1,9,17,28-tetrazaundecacyclo[22.13.1.16,9.02,22.03,20.05,18.06,16.027,35.029,34.035,38.013,39]nonatriaconta-3,5(18),11,15,19,26,29,31,33-nonaene-15,26-dicarboxylate |
SMILES (Canonical) | CCC12CC(=C3C4(C1N(CC4)CC=C2)C5=C(N3)C=C6C(=C5)C7C(O6)C(C8(CC(=C9C1(C8N7CC1)C1=CC(=C(C(=C1N9)OC)OC)O)C(=O)OC)CC)O)C(=O)OC |
SMILES (Isomeric) | CC[C@@]12CC(=C3[C@@]4([C@@H]1N(CC4)CC=C2)C5=C(N3)C=C6C(=C5)[C@H]7[C@@H](O6)[C@@H]([C@@]8(CC(=C9[C@@]1([C@@H]8N7CC1)C1=CC(=C(C(=C1N9)OC)OC)O)C(=O)OC)CC)O)C(=O)OC |
InChI | InChI=1S/C44H50N4O9/c1-7-41-10-9-13-47-14-11-43(39(41)47)24-16-21-28(18-26(24)45-34(43)22(19-41)37(51)55-5)57-33-30(21)48-15-12-44-25-17-27(49)31(53-3)32(54-4)29(25)46-35(44)23(38(52)56-6)20-42(8-2,36(33)50)40(44)48/h9-10,16-18,30,33,36,39-40,45-46,49-50H,7-8,11-15,19-20H2,1-6H3/t30-,33+,36-,39+,40+,41+,42-,43-,44-/m0/s1 |
InChI Key | XVLKCTCGGIJHCK-GXLFRJOSSA-N |
Popularity | 2 references in papers |
Molecular Formula | C44H50N4O9 |
Molecular Weight | 778.90 g/mol |
Exact Mass | 778.35777919 g/mol |
Topological Polar Surface Area (TPSA) | 151.00 Ų |
XlogP | 4.50 |
CHEMBL455807 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.28% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.02% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.17% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.13% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.17% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.14% | 90.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.93% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 89.01% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.83% | 86.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.76% | 97.28% |
CHEMBL204 | P00734 | Thrombin | 88.13% | 96.01% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.08% | 91.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.19% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.43% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.21% | 94.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.17% | 96.38% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.98% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.61% | 83.82% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.42% | 93.03% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.21% | 89.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.09% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.97% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.83% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.17% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.44% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.21% | 100.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.84% | 94.42% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tabernaemontana bovina |
Tabernaemontana divaricata |
PubChem | 44566831 |
LOTUS | LTS0132350 |
wikiData | Q104401545 |