Colubrinic acid
Internal ID | 599c9b3e-d1ad-4240-a2d5-e400c7b3c1ed |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,2R,5S,8R,9R,10R,13R,14R,15S,16R,18R)-15-formyl-16-hydroxy-1,2,14,17,17-pentamethyl-8-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosane-5-carboxylic acid |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C(C3(CC2)C)(CCC5C4(C(C(C5(C)C)O)C=O)C)C)C(=O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@H]4[C@]([C@@]3(CC2)C)(CC[C@@H]5[C@@]4([C@@H]([C@H](C5(C)C)O)C=O)C)C)C(=O)O |
InChI | InChI=1S/C30H46O4/c1-17(2)18-10-13-30(25(33)34)15-14-27(5)19(23(18)30)8-9-22-28(27,6)12-11-21-26(3,4)24(32)20(16-31)29(21,22)7/h16,18-24,32H,1,8-15H2,2-7H3,(H,33,34)/t18-,19+,20+,21-,22-,23+,24+,27+,28+,29-,30-/m0/s1 |
InChI Key | SLWJVQQNDGLXTK-IMBMMKFRSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H46O4 |
Molecular Weight | 470.70 g/mol |
Exact Mass | 470.33960994 g/mol |
Topological Polar Surface Area (TPSA) | 74.60 Ų |
XlogP | 7.50 |
Zizyberanalic acid |
CHEMBL470503 |
CHEBI:67591 |
67594-73-4 |
DTXSID501315867 |
BDBM50249140 |
AKOS040763697 |
Q27136060 |
(1R,2R,5S,8R,9R,10R,13R,14R,15S,16R,18R)-15-formyl-16-hydroxy-1,2,14,17,17-pentamethyl-8-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosane-5-carboxylic acid |
(1R,3aS,5aR,5bR,7aR,9R,10S,10aR,10bR,12aR,12bR)-10-formyl-9-hydroxy-5a,5b,8,8,10a-pentamethyl-1-(prop-1-en-2-yl)octadecahydrodicyclopenta[a,i]phenanthrene-3a(1H)-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5461 | P08151 | Zinc finger protein GLI1 |
38000 nM 38000 nM |
IC50 IC50 |
PMID: 18842418
PMID: 19309080 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.09% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.62% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.42% | 91.19% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.22% | 97.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.13% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.09% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.72% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.25% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.15% | 93.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.53% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.44% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.38% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.38% | 93.04% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.05% | 96.09% |
CHEMBL5028 | O14672 | ADAM10 | 80.21% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Breynia fruticosa |
Colubrina texensis |
Paliurus hemsleyanus |
Ziziphus jujuba |
Ziziphus mauritiana |
PubChem | 21672700 |
NPASS | NPC116146 |
ChEMBL | CHEMBL470503 |
LOTUS | LTS0104365 |
wikiData | Q27136060 |