Collybial
| Internal ID | ce19b72e-75b1-4633-b524-7334d477d4a6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Ketones |
| IUPAC Name | 2,10,10-trimethyl-4-oxotricyclo[7.2.0.02,5]undec-6-ene-6-carbaldehyde |
| SMILES (Canonical) | CC1(CC2C1CC=C(C3C2(CC3=O)C)C=O)C |
| SMILES (Isomeric) | CC1(CC2C1CC=C(C3C2(CC3=O)C)C=O)C |
| InChI | InChI=1S/C15H20O2/c1-14(2)6-11-10(14)5-4-9(8-16)13-12(17)7-15(11,13)3/h4,8,10-11,13H,5-7H2,1-3H3 |
| InChI Key | HMBNCKSBZMIUGA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 2.40 |
| CHEBI:189928 |
| DTXSID101114752 |
| 2,10,10-trimethyl-4-oxotricyclo[7.2.0.02,5]undec-6-ene-6-carbaldehyde |
| 2,10,10-Trimethyl-4-oxotricyclo[7.2.0.02,5]undec-6-ene-6-carboxaldehyde, 9CI |
| 164300-75-8 |
| Tricyclo[7.2.0.02,5]undec-6-ene-6-carboxaldehyde, 2,10,10-trimethyl-4-oxo-, (1R,2S,5S,9S)-rel-(+)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.06% | 97.25% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.37% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.72% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.30% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.81% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.39% | 100.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.53% | 85.30% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.32% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bixa orellana |
| PubChem | 85132500 |
| LOTUS | LTS0037560 |
| wikiData | Q105129954 |