Clausine O
| Internal ID | b4342bf8-bf62-4611-9293-b8601a9b90a8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 2,7-dihydroxy-9H-carbazole-3-carbaldehyde |
| SMILES (Canonical) | C1=CC2=C(C=C1O)NC3=C2C=C(C(=C3)O)C=O |
| SMILES (Isomeric) | C1=CC2=C(C=C1O)NC3=C2C=C(C(=C3)O)C=O |
| InChI | InChI=1S/C13H9NO3/c15-6-7-3-10-9-2-1-8(16)4-11(9)14-12(10)5-13(7)17/h1-6,14,16-17H |
| InChI Key | RTRVKTRUQDUIKV-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 73.30 Ų |
| XlogP | 2.70 |
| 2,7-dihydroxy-9H-carbazole-3-carbaldehyde |
| CHEBI:69936 |
| CHEMBL1689804 |
| 9H-Carbazole-3-carboxaldehyde, 2,7-dihydroxy- |
| Q27138279 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 98.04% | 98.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.96% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.42% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.17% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.76% | 91.49% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.43% | 91.71% |
| CHEMBL3194 | P02766 | Transthyretin | 89.53% | 90.71% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 88.08% | 93.24% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.06% | 98.35% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.68% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.99% | 98.75% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.08% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.76% | 98.95% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.47% | 97.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.73% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.13% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.30% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena anisata |
| Clausena excavata |
| Clausena harmandiana |
| PubChem | 11241634 |
| NPASS | NPC86834 |
| ChEMBL | CHEMBL1689804 |
| LOTUS | LTS0065704 |
| wikiData | Q27138279 |