Clausine E
| Internal ID | ea26e612-4421-4fe6-ab1f-c294a52a2641 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | methyl 1-hydroxy-9H-carbazole-3-carboxylate |
| SMILES (Canonical) | COC(=O)C1=CC2=C(C(=C1)O)NC3=CC=CC=C32 |
| SMILES (Isomeric) | COC(=O)C1=CC2=C(C(=C1)O)NC3=CC=CC=C32 |
| InChI | InChI=1S/C14H11NO3/c1-18-14(17)8-6-10-9-4-2-3-5-11(9)15-13(10)12(16)7-8/h2-7,15-16H,1H3 |
| InChI Key | ZWPODTIRGFOENJ-UHFFFAOYSA-N |
| Popularity | 13 references in papers |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 62.30 Ų |
| XlogP | 2.90 |
| 182261-83-2 |
| methyl 1-hydroxy-9H-carbazole-3-carboxylate |
| CHEBI:69930 |
| 9H-Carbazole-3-carboxylic acid, 1-hydroxy-, methyl ester |
| CHEMBL235934 |
| HY-N10340 |
| AKOS040763681 |
| CS-0380745 |
| Q27138274 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.71% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.83% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.26% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.96% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.71% | 96.09% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.32% | 92.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.24% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.56% | 94.73% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.78% | 97.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.73% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.58% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.23% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.52% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.05% | 94.75% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 80.96% | 98.21% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.30% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena anisata |
| Clausena excavata |
| Clausena harmandiana |
| PubChem | 5315951 |
| NPASS | NPC118228 |
| ChEMBL | CHEMBL235934 |
| LOTUS | LTS0245787 |
| wikiData | Q27138274 |