Clauraila A
| Internal ID | 0c02ff8d-4098-447a-87cf-2677d0dd31a6 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 1,7-dimethoxy-9H-carbazole-3-carbaldehyde |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(N2)C(=CC(=C3)C=O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(N2)C(=CC(=C3)C=O)OC |
| InChI | InChI=1S/C15H13NO3/c1-18-10-3-4-11-12-5-9(8-17)6-14(19-2)15(12)16-13(11)7-10/h3-8,16H,1-2H3 |
| InChI Key | LEYWMXGGVZTHDM-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.08954328 g/mol |
| Topological Polar Surface Area (TPSA) | 51.30 Ų |
| XlogP | 2.80 |
| CHEBI:69922 |
| Claurailas A |
| Clauralia A |
| CHEMBL1689795 |
| Q27138266 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.60% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.42% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.83% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.71% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.84% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.68% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.38% | 90.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 87.06% | 93.24% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.95% | 86.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.16% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.28% | 86.33% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.21% | 98.59% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.43% | 99.17% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.04% | 85.30% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.91% | 91.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.77% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena harmandiana |
| PubChem | 51039825 |
| NPASS | NPC208084 |
| ChEMBL | CHEMBL1689795 |
| LOTUS | LTS0011133 |
| wikiData | Q27138266 |