Ciwujianoside E
Internal ID | 547eee2c-abb5-4f5f-be7c-3cb7d1725ae1 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C(C3(C)C)CCC5(C4CC=C6C5(CCC7(C6CC(=C)CC7)C(=O)O)C)C)C)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3CC[C@]4([C@H](C3(C)C)CC[C@@]5([C@@H]4CC=C6[C@]5(CC[C@@]7([C@H]6CC(=C)CC7)C(=O)O)C)C)C)O)O)O)O)O |
InChI | InChI=1S/C40H62O11/c1-20-10-15-40(35(46)47)17-16-38(6)22(23(40)18-20)8-9-26-37(5)13-12-27(36(3,4)25(37)11-14-39(26,38)7)50-34-32(29(43)24(41)19-48-34)51-33-31(45)30(44)28(42)21(2)49-33/h8,21,23-34,41-45H,1,9-19H2,2-7H3,(H,46,47)/t21-,23-,24-,25-,26+,27-,28-,29-,30+,31+,32+,33-,34-,37-,38+,39+,40-/m0/s1 |
InChI Key | AGKHJTRNGBZWDZ-CUZSZSPKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H62O11 |
Molecular Weight | 718.90 g/mol |
Exact Mass | 718.42921279 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 3.60 |
114912-36-6 |
CHEMBL3798016 |
(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
BDBM50167265 |
AKOS040761514 |
FS-7835 |
F92878 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.39% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.43% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.98% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.91% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.42% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.10% | 92.94% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.88% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.80% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 86.24% | 97.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.59% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.29% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus senticosus |
Guaiacum officinale |
PubChem | 21626484 |
LOTUS | LTS0051683 |
wikiData | Q104911846 |