cis-Dihydronarciclasine
Internal ID | 344b0d9f-575b-4102-b287-aa6d14db536e |
Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Phenanthridine- and phenanthridone-type amaryllidaceae alkaloids |
IUPAC Name | 2,3,4,7-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
SMILES (Canonical) | C1C2C(C(C(C1O)O)O)NC(=O)C3=C(C4=C(C=C23)OCO4)O |
SMILES (Isomeric) | C1C2C(C(C(C1O)O)O)NC(=O)C3=C(C4=C(C=C23)OCO4)O |
InChI | InChI=1S/C14H15NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h2,5-6,9-10,12,16-19H,1,3H2,(H,15,20) |
InChI Key | SBTGHBALOCEVOR-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C14H15NO7 |
Molecular Weight | 309.27 g/mol |
Exact Mass | 309.08485182 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | -0.60 |
40042-04-4 |
NSC381837 |
CHEMBL1987575 |
DTXSID50960504 |
NSC381838 |
NSC-381837 |
NSC-381838 |
B657832K144 |
B657832K145 |
1,2,3,4,4a,11b-Hexahydro-9H-[1,3]dioxolo[4,5-j]phenanthridine-2,3,4,6,7-pentol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.49% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.62% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.45% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.39% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.19% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.15% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.97% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.06% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.59% | 95.56% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.83% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.32% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.25% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.66% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.27% | 92.62% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.66% | 96.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.53% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zephyranthes candida |
PubChem | 436050 |
LOTUS | LTS0208744 |
wikiData | Q82941722 |