Cineverine
Internal ID | 4a8295de-4a17-422c-a646-d5c010989ef7 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
IUPAC Name | [(1S,2S,4S,9S,10R)-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] 3,4-dimethoxybenzoate |
SMILES (Canonical) | COC1=C(C=C(C=C1)C(=O)OC2CCN3CC4CC(C3C2)CN5C4CCCC5=O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C(=O)O[C@H]2CCN3C[C@@H]4C[C@H]([C@@H]3C2)CN5[C@@H]4CCCC5=O)OC |
InChI | InChI=1S/C24H32N2O5/c1-29-21-7-6-15(11-22(21)30-2)24(28)31-18-8-9-25-13-16-10-17(20(25)12-18)14-26-19(16)4-3-5-23(26)27/h6-7,11,16-20H,3-5,8-10,12-14H2,1-2H3/t16-,17-,18-,19+,20-/m0/s1 |
InChI Key | NSCGXCFTTLNOMA-FSGKZVOOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H32N2O5 |
Molecular Weight | 428.50 g/mol |
Exact Mass | 428.23112213 g/mol |
Topological Polar Surface Area (TPSA) | 68.30 Ų |
XlogP | 2.80 |
InChI=1/C24H32N2O5/c1-29-21-7-6-15(11-22(21)30-2)24(28)31-18-8-9-25-13-16-10-17(20(25)12-18)14-26-19(16)4-3-5-23(26)27/h6-7,11,16-20H,3-5,8-10,12-14H2,1-2H3/t16?,17?,18-,19-,20-/m0/s |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.86% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.80% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 94.62% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.42% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.42% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.31% | 86.33% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 90.93% | 91.43% |
CHEMBL2535 | P11166 | Glucose transporter | 90.92% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.51% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.83% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.99% | 93.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.91% | 93.99% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.77% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.07% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.93% | 90.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.84% | 90.24% |
CHEMBL2443 | P49862 | Kallikrein 7 | 83.00% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.80% | 97.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.73% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.38% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Genista cinerea |
Genista pilosa |
PubChem | 15939894 |
LOTUS | LTS0236023 |
wikiData | Q104250434 |