CID 91895323
Internal ID | 4864bcf3-7a8f-4338-8af2-6a3840db6de7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1S,2S,5S,8R,9S,10S,11R,12R,15R,18R)-9,10,15,18-tetrahydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCC(C23C1C(C(C45C2CCC(C4O)C(=C)C5=O)(OC3)O)O)O)C |
SMILES (Isomeric) | CC(=O)OC[C@@]1(CC[C@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H]([C@H]4O)C(=C)C5=O)(OC3)O)O)O)C |
InChI | InChI=1S/C22H30O8/c1-10-12-4-5-13-20-9-30-22(28,21(13,16(10)25)17(12)26)18(27)15(20)19(3,7-6-14(20)24)8-29-11(2)23/h12-15,17-18,24,26-28H,1,4-9H2,2-3H3/t12-,13-,14+,15+,17+,18-,19-,20+,21-,22+/m0/s1 |
InChI Key | WXIZMFKMNALSKU-BWCLEITDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H30O8 |
Molecular Weight | 422.50 g/mol |
Exact Mass | 422.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 134.00 Ų |
XlogP | -0.60 |
304642-94-2 |
[(1S,2S,5S,8R,9S,10S,11R,12R,15R,18R)-9,10,15,18-tetrahydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
CID 91895323 |
11-Deoxyxerophilusin VI; 19-Acetylxerophilusin III; 3-Deoxyxerophilusin VII |
HY-N1062 |
AKOS032961589 |
CS-0016346 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.92% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.03% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.43% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.34% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.00% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.80% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.40% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.39% | 91.19% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.23% | 97.28% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.76% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.94% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.02% | 93.04% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.12% | 96.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.81% | 92.94% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.72% | 95.71% |
CHEMBL5028 | O14672 | ADAM10 | 80.86% | 97.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.67% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.61% | 95.89% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.53% | 97.78% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.02% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon xerophilus |
PubChem | 91895323 |
LOTUS | LTS0181355 |
wikiData | Q105314673 |