CID 52952013
Internal ID | 100feaea-d06b-4c82-9362-2b82b5e4ed22 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(1R,2R,5S,6R,10R,11S,12R,15R,16R,18S,19R)-18-acetyloxy-6-(furan-3-yl)-11-hydroxy-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-16-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC(C2(C3CCC4(C(CC=C4C3(C(C5C2C1(CO5)C)O)C)C6=COC=C6)C)C)OC(=O)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1C[C@@H]([C@@]2([C@H]3CC[C@]4([C@@H](CC=C4[C@@]3([C@@H]([C@H]5[C@H]2[C@@]1(CO5)C)O)C)C6=COC=C6)C)C)OC(=O)C |
InChI | InChI=1S/C30H40O7/c1-16(31)36-22-13-23(37-17(2)32)30(6)21-9-11-27(3)19(18-10-12-34-14-18)7-8-20(27)29(21,5)26(33)24-25(30)28(22,4)15-35-24/h8,10,12,14,19,21-26,33H,7,9,11,13,15H2,1-6H3/t19-,21-,22+,23-,24+,25-,26+,27-,28+,29-,30-/m0/s1 |
InChI Key | WGBLBVXSYGYVPN-VQDQNZKNSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H40O7 |
Molecular Weight | 512.60 g/mol |
Exact Mass | 512.27740361 g/mol |
Topological Polar Surface Area (TPSA) | 95.20 Ų |
XlogP | 4.20 |
78012-28-9 |
CHEBI:67293 |
DIACETYLVILASININ |
CHEMBL2229171 |
AKOS040760866 |
FS-9259 |
Q27135752 |
(1S,3R,3aR,5aR,6S,6aR,9R,9aS,11aR,11bR,11cR)-9-(furan-3-yl)-6-hydroxy-3a,6a,9a,11b-tetramethyl-1,2,3,3a,4,5a,6,6a,8,9,9a,10,11,11a,11b,11c-hexadecahydrocyclopenta[7,8]phenanthro[10,1-bc]furan-1,3-diyl diacetate |
[(1R,2R,5S,6R,10R,11S,12R,15R,16R,18S,19R)-18-Acetyloxy-6-(furan-3-yl)-11-hydroxy-1,5,10,15-tetramethyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-16-yl] acetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha |
49 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.17% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.86% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.02% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.44% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.40% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.78% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.14% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.42% | 86.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.76% | 97.28% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.53% | 92.62% |
CHEMBL5028 | O14672 | ADAM10 | 83.57% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.49% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.98% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Melia volkensii |
Turraea holstii |
PubChem | 52952013 |
LOTUS | LTS0193854 |
wikiData | Q27135752 |