CID 24721116
Internal ID | e884249c-3430-4b9d-b7f3-4d2662d79943 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2-[(3S,5S)-6,10-dimethylspiro[4.5]dec-9-en-3-yl]propan-2-ol |
SMILES (Canonical) | CC1CCC=C(C12CCC(C2)C(C)(C)O)C |
SMILES (Isomeric) | CC1CCC=C([C@]12CC[C@@H](C2)C(C)(C)O)C |
InChI | InChI=1S/C15H26O/c1-11-6-5-7-12(2)15(11)9-8-13(10-15)14(3,4)16/h6,12-13,16H,5,7-10H2,1-4H3/t12?,13-,15+/m0/s1 |
InChI Key | ICWHTQRTTHCUHW-RGPPAHDHSA-N |
Popularity | 21 references in papers |
Molecular Formula | C15H26O |
Molecular Weight | 222.37 g/mol |
Exact Mass | 222.198365449 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 3.70 |
23811-08-7 |
(-)-Hinesol |
2-[(3S,5S)-6,10-Dimethylspiro[4.5]dec-9-en-3-yl]propan-2-ol |
AC-35133 |
2-((2S,5S)-6,10-dimethylspiro[4.5]dec-6-en-2-yl)propan-2-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.88% | 97.25% |
CHEMBL1871 | P10275 | Androgen Receptor | 91.76% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.06% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.61% | 91.11% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.33% | 93.04% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.43% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.40% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.31% | 97.79% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.66% | 86.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.79% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Akebia quinata |
Akebia trifoliata |
Aquilaria malaccensis |
Aquilaria sinensis |
Atractylodes lancea |
Atractylodes macrocephala |
Ferula fukanensis |
Piper lhotzkyanum |
PubChem | 24721116 |
NPASS | NPC135388 |
LOTUS | LTS0246076 |
wikiData | Q104375582 |