CID 16745528
Internal ID | 8924cf31-0b9f-4eb0-ac20-3df570ba880c |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1S,12S,13R,14R)-18,19-dimethoxy-13,14-dimethyl-20-oxo-3,6,8-trioxapentacyclo[9.9.1.01,16.04,21.05,9]henicosa-4(21),5(9),10,16,18-pentaen-12-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(CC2=CC(=C(C(=O)C23COC4=C3C1=CC5=C4OCO5)OC)OC)C)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@@H](CC2=CC(=C(C(=O)[C@@]23COC4=C3C1=CC5=C4OCO5)OC)OC)C)C |
InChI | InChI=1S/C27H30O8/c1-7-13(2)26(29)35-21-15(4)14(3)8-16-9-18(30-5)23(31-6)25(28)27(16)11-32-24-20(27)17(21)10-19-22(24)34-12-33-19/h7,9-10,14-15,21H,8,11-12H2,1-6H3/b13-7-/t14-,15-,21+,27+/m1/s1 |
InChI Key | CGWKMZYZZCWGCK-DITIAMETSA-N |
Popularity | 8 references in papers |
Molecular Formula | C27H30O8 |
Molecular Weight | 482.50 g/mol |
Exact Mass | 482.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 89.50 Ų |
XlogP | 4.10 |
MLS000728489 |
CHEMBL1444176 |
HMS2214O11 |
SMR000445696 |
[(1S,12S,13R,14R)-18,19-dimethoxy-13,14-dimethyl-20-oxo-3,6,8-trioxapentacyclo[9.9.1.01,16.04,21.05,9]henicosa-4(21),5(9),10,16,18-pentaen-12-yl] (Z)-2-methylbut-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2392 | P06746 | DNA polymerase beta |
562.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 96.38% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 94.99% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.58% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.35% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.87% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.67% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.75% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.75% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.62% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.35% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.21% | 91.19% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.72% | 98.75% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.38% | 97.05% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.60% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.11% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 83.00% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.20% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.95% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.52% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.43% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.02% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.83% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura heteroclita |
PubChem | 16745528 |
LOTUS | LTS0081338 |
wikiData | Q104958320 |