CID 163102243
Internal ID | 14b2c16f-50d3-45a3-a403-505769ab1e90 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | |
SMILES (Canonical) | CC1C(C(=O)C2C(CCCC2(C13CCC4(O3)COC=C4)C)(C)C)O |
SMILES (Isomeric) | CC1C(C(=O)C2C(CCCC2(C13CCC4(O3)COC=C4)C)(C)C)O |
InChI | InChI=1S/C20H30O4/c1-13-14(21)15(22)16-17(2,3)6-5-7-18(16,4)20(13)9-8-19(24-20)10-11-23-12-19/h10-11,13-14,16,21H,5-9,12H2,1-4H3 |
InChI Key | LRQKKQYUECPRMI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O4 |
Molecular Weight | 334.40 g/mol |
Exact Mass | 334.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of CID 163102243 2D Structure of CID 163102243](https://plantaedb.com/storage/docs/compounds/2023/11/cid-163102243.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.89% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.58% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.41% | 95.56% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 89.89% | 95.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.06% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.86% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.79% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.25% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.94% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.20% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.73% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.68% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.70% | 93.04% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.61% | 96.77% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.30% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonurus japonicus |
Otostegia fruticosa |
Pseudodictamnus aucheri |
PubChem | 163102243 |
LOTUS | LTS0117092 |
wikiData | Q105156256 |