CID 16169193
Internal ID | 4336e823-0e6a-418a-ac5e-abcabf996071 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)OC5=C(C(=C(C=C5C(=O)OC6C7C(C(C(O6)CO)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O7)O)O)O)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O3)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)OC5=C(C(=C(C=C5C(=O)OC6C7C(C(C(O6)CO)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O7)O)O)O)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O3)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C68H48O44/c69-10-29-45(86)55-57(109-64(99)17-7-25(75)42(83)50(91)35(17)33-15(62(97)107-55)5-23(73)40(81)48(33)89)67(104-29)112-66(101)19-9-27(77)44(85)52(93)53(19)103-28-2-12(1-20(70)37(28)78)59(94)111-68-58-56(108-63(98)16-6-24(74)41(82)49(90)34(16)36-18(65(100)110-58)8-26(76)43(84)51(36)92)54-30(105-68)11-102-60(95)13-3-21(71)38(79)46(87)31(13)32-14(61(96)106-54)4-22(72)39(80)47(32)88/h1-9,29-30,45,54-58,67-93H,10-11H2 |
InChI Key | JTLKOBJLOBOCLO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C68H48O44 |
Molecular Weight | 1569.10 g/mol |
Exact Mass | 1568.1518448 g/mol |
Topological Polar Surface Area (TPSA) | 744.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.43% | 96.21% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.78% | 95.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.39% | 94.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.13% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.79% | 99.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.56% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.21% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.88% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.38% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.93% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.48% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 86.14% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.04% | 96.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.17% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.94% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.21% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.82% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.68% | 95.50% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.42% | 83.57% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.19% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 82.98% | 98.75% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.86% | 83.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.76% | 95.78% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.94% | 99.15% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.22% | 89.34% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.13% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.84% | 99.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.07% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rosa laevigata |
PubChem | 16169193 |
LOTUS | LTS0202006 |
wikiData | Q105134844 |