CID 16167195
Internal ID | a7d37324-ce66-49f6-894d-29651cdf1802 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Complex tannins |
IUPAC Name | 46-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C3C4C5C6C(COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O6)O)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C(=C1O)O)O)C1=C(C3=C(C(=C1O)O)O)C(=O)O4)C(=O)O5)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=CC(=C2C3C4C5C6C(COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O6)O)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9C1=C(C(=C(C(=C1O)O)O)C1=C(C3=C(C(=C1O)O)O)C(=O)O4)C(=O)O5)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
InChI | InChI=1S/C56H38O31/c57-15-2-1-10(3-17(15)59)47-22(64)4-11-16(58)8-18(60)27(48(11)84-47)32-31-34-30(43(73)46(76)44(31)74)29-33-28(41(71)45(75)42(29)72)26-14(7-21(63)37(67)40(26)70)53(78)83-23-9-82-52(77)12-5-19(61)35(65)38(68)24(12)25-13(6-20(62)36(66)39(25)69)54(79)85-49(23)51(87-56(33)81)50(32)86-55(34)80/h1-3,5-8,22-23,32,47,49-51,57-76H,4,9H2 |
InChI Key | DRHVFLXLYQESEQ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C56H38O31 |
Molecular Weight | 1206.90 g/mol |
Exact Mass | 1206.13970441 g/mol |
Topological Polar Surface Area (TPSA) | 545.00 Ų |
XlogP | 3.00 |
Q4677960 |
46-[2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-8-yl]-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37-pentadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
![2D Structure of CID 16167195 2D Structure of CID 16167195](https://plantaedb.com/storage/docs/compounds/2023/11/cid-16167195.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.56% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.66% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.27% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.48% | 95.56% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 91.75% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.62% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.38% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.59% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.59% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.56% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.88% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.86% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 85.40% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.02% | 94.73% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.57% | 85.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.69% | 94.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.23% | 93.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.10% | 100.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.75% | 96.37% |
CHEMBL3820 | P35557 | Hexokinase type IV | 81.37% | 91.96% |
CHEMBL3194 | P02766 | Transthyretin | 80.92% | 90.71% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 80.58% | 97.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Psidium guajava |
Quercus acutissima |
Terminalia catappa |
PubChem | 16167195 |
LOTUS | LTS0151816 |
wikiData | Q104987422 |