CID 13889713
Internal ID | 1fb6fab5-ac0a-4292-b32b-0cedbe771d7e |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | (3S,3aR,6R,6aR)-3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)[C@@H]2[C@H]3CO[C@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)OC)OC)OC |
InChI | InChI=1S/C23H28O7/c1-24-17-7-6-13(8-18(17)25-2)21-15-11-30-22(16(15)12-29-21)14-9-19(26-3)23(28-5)20(10-14)27-4/h6-10,15-16,21-22H,11-12H2,1-5H3/t15-,16-,21+,22-/m0/s1 |
InChI Key | MFIHSKBTNZNJIK-FRMGNDQPSA-N |
Popularity | 27 references in papers |
Molecular Formula | C23H28O7 |
Molecular Weight | 416.50 g/mol |
Exact Mass | 416.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 2.90 |
41689-51-4 |
(1S,3aR,4R,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)hexahydrofuro[3,4-c]furan |
HY-N5107 |
AKOS040760381 |
AC-34052 |
MS-27242 |
CS-0032387 |
(3S,3Ar,6R,6aR)-3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
903 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.87% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.34% | 92.98% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.09% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.93% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.80% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.56% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.37% | 89.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.64% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.59% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 85.26% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.92% | 94.00% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.74% | 94.03% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.48% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.34% | 99.17% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.26% | 85.49% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.19% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hernandia nymphaeifolia |
Magnolia biondii |
PubChem | 13889713 |
LOTUS | LTS0046140 |
wikiData | Q104400369 |