CID 10648327
Internal ID | ecdc070c-b831-4874-b3f6-9c66720b0cc8 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1R,2R)-1,5-bis(3,4-dihydroxyphenyl)-1-hydroxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=C(C=C1C#CCC(C(C2=CC(=C(C=C2)O)O)O)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C#CC[C@H]([C@@H](C2=CC(=C(C=C2)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |
InChI | InChI=1S/C23H26O11/c24-10-18-20(30)21(31)22(32)23(34-18)33-17(19(29)12-5-7-14(26)16(28)9-12)3-1-2-11-4-6-13(25)15(27)8-11/h4-9,17-32H,3,10H2/t17-,18-,19-,20-,21+,22-,23-/m1/s1 |
InChI Key | STEZVHWESYNLGU-XRWAXFQNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O11 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | -0.20 |
111518-94-6 |
(2R,3R,4S,5S,6R)-2-[(1R,2R)-1,5-bis(3,4-dihydroxyphenyl)-1-hydroxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
HY-N3167 |
AKOS032948161 |
FS-10142 |
CS-0023469 |
F92845 |
-D-Glucopyranoside, (1R)-4-(3,4-dihydroxyphenyl)-1-[(R)-(3,4-dihydroxyphenyl)hydroxymethyl]-3-butynyl (9CI); (1R)-4-(3,4-Dihydroxyphenyl)-1-[(R)-(3,4-dihydroxyphenyl)hydroxymethyl]-3-butyn-1-yl -D-glucopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.93% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.41% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.17% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 88.09% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.92% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.29% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.64% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.39% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.26% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.86% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.56% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.13% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.68% | 94.62% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.40% | 94.23% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.85% | 89.62% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.37% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.01% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.00% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curculigo pilosa |
Hypoxis nyasica |
PubChem | 10648327 |
LOTUS | LTS0160057 |
wikiData | Q105260229 |