Chushizisin I
Internal ID | 4de5f559-b5b0-46e5-a1fe-13550cf34481 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 4-[(3S,3aR,6S,6aR)-6-[(2S,3R)-3-(hydroxymethyl)-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]phenol |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2CO)C3=CC=C(C=C3)O)C4C5COC(C5CO4)C6=CC=C(C=C6)O |
SMILES (Isomeric) | COC1=CC(=CC2=C1O[C@@H]([C@H]2CO)C3=CC=C(C=C3)O)[C@@H]4[C@H]5CO[C@@H]([C@H]5CO4)C6=CC=C(C=C6)O |
InChI | InChI=1S/C28H28O7/c1-32-24-11-17(10-20-21(12-29)27(35-28(20)24)16-4-8-19(31)9-5-16)26-23-14-33-25(22(23)13-34-26)15-2-6-18(30)7-3-15/h2-11,21-23,25-27,29-31H,12-14H2,1H3/t21-,22-,23-,25+,26+,27+/m0/s1 |
InChI Key | RTNCSBDPDVORAW-GGCVXMFDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H28O7 |
Molecular Weight | 476.50 g/mol |
Exact Mass | 476.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 97.60 Ų |
XlogP | 3.00 |
CHEMBL560168 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.33% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.56% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.09% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.41% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.29% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.20% | 89.62% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.14% | 89.44% |
CHEMBL2581 | P07339 | Cathepsin D | 86.11% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.09% | 97.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.11% | 95.89% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.92% | 93.10% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.38% | 86.92% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.04% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.89% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 80.67% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.61% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 42639663 |
LOTUS | LTS0239142 |
wikiData | Q105245275 |