Chushizisin E
Internal ID | 8e69234f-e26f-4bc1-ada8-a0fb74cc32ef |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 4-[(2S,3R)-3-(hydroxymethyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]phenol |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2CO)C3=CC=C(C=C3)O)CCCO |
SMILES (Isomeric) | COC1=CC(=CC2=C1O[C@@H]([C@H]2CO)C3=CC=C(C=C3)O)CCCO |
InChI | InChI=1S/C19H22O5/c1-23-17-10-12(3-2-8-20)9-15-16(11-21)18(24-19(15)17)13-4-6-14(22)7-5-13/h4-7,9-10,16,18,20-22H,2-3,8,11H2,1H3/t16-,18+/m0/s1 |
InChI Key | LLBVZGBPQIMZCG-FUHWJXTLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H22O5 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 2.10 |
CHEMBL571673 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.71% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.65% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.05% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.75% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.03% | 86.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.89% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.59% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.20% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.82% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.09% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.48% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 81.41% | 98.75% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.82% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 44188450 |
LOTUS | LTS0197489 |
wikiData | Q105153401 |