Chromone
| Internal ID | 03529a12-49c1-484c-8cbc-8644e3448321 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | chromen-4-one |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C=CO2 |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C=CO2 |
| InChI | InChI=1S/C9H6O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H |
| InChI Key | OTAFHZMPRISVEM-UHFFFAOYSA-N |
| Popularity | 2,351 references in papers |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.036779430 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A |
39900 nM |
IC50 |
PMID: 22850212
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.76% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.59% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.58% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.58% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.75% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 83.71% | 85.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.61% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Conioselinum anthriscoides |
| Myroxylon peruiferum |
| Saposhnikovia divaricata |
| PubChem | 10286 |
| NPASS | NPC279916 |
| ChEMBL | CHEMBL13311 |
| LOTUS | LTS0085606 |
| wikiData | Q420156 |