chloranthalactone E 8-O-beta-D-glucopyranoside
Internal ID | a9af8195-b22b-4819-9ca4-5cc2dad58fd9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Eudesmanolides, secoeudesmanolides, and derivatives |
IUPAC Name | (1S,7R,8S,9S,10R,12S)-8-hydroxy-4,9-dimethyl-13-methylidene-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxatetracyclo[7.4.0.03,7.010,12]tridec-3-en-5-one |
SMILES (Canonical) | CC1=C2CC3C(=C)C4CC4C3(C(C2(OC1=O)OC5C(C(C(C(O5)CO)O)O)O)O)C |
SMILES (Isomeric) | CC1=C2C[C@H]3C(=C)[C@H]4C[C@H]4[C@@]3([C@@H]([C@@]2(OC1=O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C |
InChI | InChI=1S/C21H28O9/c1-7-9-4-12(9)20(3)10(7)5-11-8(2)17(26)29-21(11,19(20)27)30-18-16(25)15(24)14(23)13(6-22)28-18/h9-10,12-16,18-19,22-25,27H,1,4-6H2,2-3H3/t9-,10+,12-,13-,14-,15+,16-,18+,19+,20-,21+/m1/s1 |
InChI Key | VYBFUWGHQFZSNX-XMEUBQTBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H28O9 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.17333247 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -1.20 |
CHEMBL520440 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.82% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.46% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.43% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.00% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.56% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.64% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.84% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.77% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.91% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.76% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.62% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.73% | 86.92% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.42% | 94.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.36% | 95.83% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.88% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sarcandra glabra |
PubChem | 11647529 |
LOTUS | LTS0184323 |
wikiData | Q105298868 |