Chinensioside B
Internal ID | 97f33cf2-0a2a-4229-a090-aa87168d1192 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-8-(hydroxymethyl)-9-[(2S,3R,4S,5S)-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(C4C6CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)CO)OC9C(C(C(CO9)OC1C(C(C(C(O1)CO)O)O)O)O)OC1C(C(C(C(O1)C)O)O)O)C)C(=C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@]45CC[C@H]([C@@H]4[C@H]6CC[C@@H]7[C@]8(CC[C@@H]([C@@]([C@@H]8CC[C@]7([C@@]6(CC5)C)C)(C)CO)O[C@H]9[C@@H]([C@H]([C@H](CO9)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)C)C(=C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C65H106O31/c1-24(2)27-11-16-65(60(84)96-58-50(82)45(77)40(72)31(91-58)21-85-54-51(83)46(78)52(30(20-67)90-54)94-55-47(79)42(74)37(69)25(3)87-55)18-17-63(7)28(36(27)65)9-10-34-61(5)14-13-35(62(6,23-68)33(61)12-15-64(34,63)8)93-59-53(95-56-48(80)43(75)38(70)26(4)88-56)41(73)32(22-86-59)92-57-49(81)44(76)39(71)29(19-66)89-57/h25-59,66-83H,1,9-23H2,2-8H3/t25-,26-,27-,28+,29+,30+,31+,32-,33+,34+,35-,36+,37-,38-,39+,40+,41-,42+,43+,44-,45-,46+,47+,48+,49+,50+,51+,52+,53+,54+,55-,56-,57-,58-,59-,61-,62-,63+,64+,65-/m0/s1 |
InChI Key | WKNXZHOQPHRDKT-RUGHYGOFSA-N |
Popularity | 2 references in papers |
Molecular Formula | C65H106O31 |
Molecular Weight | 1383.50 g/mol |
Exact Mass | 1382.6718066 g/mol |
Topological Polar Surface Area (TPSA) | 492.00 Ų |
XlogP | -2.80 |
Pulsatilloside E |
366814-43-9 |
Pulchinenoside E |
pulsatillosideE;3-O-D-glucopyranosyl(1-->3)-L-rhamnopyranosyl(1-->2)-L-arabinopyranosyllupinicacid-28-O-rhamnopyranosyl(1-->4)glucopyranosyl(1-->6)glucopyranoside |
CHEMBL509384 |
DTXSID901316829 |
AKOS040760655 |
HY-125702 |
CS-0093087 |
3beta-(2-O-alpha-L-Rhamnopyranosyl-4-O-beta-D-glucopyranosyl-alpha-L-arabinopyranosyloxy)-23-hydroxylupa-20(29)-en-28-oic acid 6-O-(4-O-alpha-L-rhamnopyranosyl-beta-D-glucopyranosyl)-beta-D-glucopyranosyl ester |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.88% | 97.36% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.84% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.91% | 97.93% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.18% | 91.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.53% | 96.09% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 91.47% | 97.33% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.09% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.44% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.17% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 90.13% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.65% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.32% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.77% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.49% | 95.50% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 86.67% | 91.83% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.45% | 97.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.23% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.72% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.60% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.87% | 94.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.80% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.69% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.46% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.44% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.38% | 97.50% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.08% | 85.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.53% | 89.05% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.04% | 100.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.95% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.94% | 96.77% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.89% | 97.53% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.72% | 92.98% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.54% | 99.17% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.47% | 96.90% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.15% | 99.17% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.75% | 93.10% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.58% | 93.04% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.35% | 95.83% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.19% | 96.38% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.72% | 96.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.60% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.11% | 96.43% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.05% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pulsatilla chinensis |