(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2R)-4-[(1S,2S,4S,8S,9S,12S,13R,14R,16R)-16-hydroxy-7,9,13-trimethyl-14-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-6-yl]-2-methylbutoxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | f31c8188-4ea9-4440-a8ed-d4f874cc8868 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2R)-4-[(1S,2S,4S,8S,9S,12S,13R,14R,16R)-16-hydroxy-7,9,13-trimethyl-14-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-6-yl]-2-methylbutoxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OCC(C)CCC3=C(C4C(O3)CC5C4(CCC6C5CC=C7C6(C(CC(C7)O)OC8C(C(C(C(O8)CO)O)O)O)C)C)C)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC[C@H](C)CCC3=C([C@H]4[C@@H](O3)C[C@@H]5[C@@]4(CC[C@H]6[C@H]5CC=C7[C@@]6([C@@H](C[C@@H](C7)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O)C)C)C)CO)O)O)O)O)O |
InChI | InChI=1S/C45H72O18/c1-18(17-57-43-40(37(54)34(51)29(16-47)61-43)63-41-38(55)35(52)32(49)20(3)58-41)6-9-26-19(2)31-27(59-26)14-25-23-8-7-21-12-22(48)13-30(45(21,5)24(23)10-11-44(25,31)4)62-42-39(56)36(53)33(50)28(15-46)60-42/h7,18,20,22-25,27-43,46-56H,6,8-17H2,1-5H3/t18-,20+,22-,23-,24+,25+,27+,28-,29-,30-,31+,32+,33+,34-,35-,36+,37+,38-,39-,40-,41+,42+,43-,44+,45+/m1/s1 |
InChI Key | LXYJZECGEIAZOD-GITVNLFTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H72O18 |
Molecular Weight | 901.00 g/mol |
Exact Mass | 900.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 287.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2R)-4-[(1S,2S,4S,8S,9S,12S,13R,14R,16R)-16-hydroxy-7,9,13-trimethyl-14-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-6-yl]-2-methylbutoxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2R)-4-[(1S,2S,4S,8S,9S,12S,13R,14R,16R)-16-hydroxy-7,9,13-trimethyl-14-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-6-yl]-2-methylbutoxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/cfc9aae0-8623-11ee-bb3a-d1a61d6175c6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.86% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.33% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.07% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.45% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.23% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.44% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.50% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.83% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.35% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.61% | 96.61% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.01% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.40% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.32% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.60% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.59% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.87% | 99.17% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 82.62% | 91.65% |
CHEMBL2581 | P07339 | Cathepsin D | 82.09% | 98.95% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.78% | 98.46% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.43% | 90.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.43% | 94.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.74% | 92.50% |
CHEMBL5028 | O14672 | ADAM10 | 80.45% | 97.50% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.03% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium ascalonicum |
PubChem | 102206755 |
LOTUS | LTS0082216 |
wikiData | Q105159161 |