5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 4c430403-63ee-4b4e-8306-6fdce84e9685 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O |
InChI | InChI=1S/C28H32O17/c1-40-13-3-2-9(4-11(13)31)25-26(45-28-24(39)22(37)19(34)16(8-30)44-28)20(35)17-12(32)5-10(6-14(17)42-25)41-27-23(38)21(36)18(33)15(7-29)43-27/h2-6,15-16,18-19,21-24,27-34,36-39H,7-8H2,1H3/t15-,16+,18+,19+,21-,22-,23+,24+,27+,28-/m0/s1 |
InChI Key | XNKMKJDPUXBNMH-QLEQJCDNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O17 |
Molecular Weight | 640.50 g/mol |
Exact Mass | 640.16394955 g/mol |
Topological Polar Surface Area (TPSA) | 275.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one 2D Structure of 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/cf329590-843f-11ee-b7d0-89a4cbcc3428.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.03% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.95% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.23% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.12% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.49% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.10% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.78% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.31% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.88% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.43% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.99% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.82% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.81% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.29% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.93% | 96.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.85% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 81.96% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.71% | 95.89% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.10% | 95.53% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.16% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum bungeanum |
PubChem | 163032764 |
LOTUS | LTS0120113 |
wikiData | Q105331738 |