Centapicrin
Internal ID | c985b5cf-8e3d-4b29-bbbd-02fa38b954d7 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | 3-[[(2R,3R,4S,5R,6S)-4-acetyloxy-6-[[(3S,4R,4aS)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-3,5-dihydroxyoxan-2-yl]methoxy]benzoic acid |
SMILES (Canonical) | CC(=O)OC1C(C(OC(C1O)OC2C(C3CCOC(=O)C3=CO2)C=C)COC4=CC=CC(=C4)C(=O)O)O |
SMILES (Isomeric) | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O)O[C@H]2[C@@H]([C@@H]3CCOC(=O)C3=CO2)C=C)COC4=CC=CC(=C4)C(=O)O)O |
InChI | InChI=1S/C25H28O12/c1-3-15-16-7-8-32-23(31)17(16)10-34-24(15)37-25-20(28)21(35-12(2)26)19(27)18(36-25)11-33-14-6-4-5-13(9-14)22(29)30/h3-6,9-10,15-16,18-21,24-25,27-28H,1,7-8,11H2,2H3,(H,29,30)/t15-,16+,18-,19-,20-,21+,24+,25+/m1/s1 |
InChI Key | LHLGEBVUMRLNOA-PGAAGXEPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O12 |
Molecular Weight | 520.50 g/mol |
Exact Mass | 520.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 167.00 Ų |
XlogP | 1.00 |
59193-73-6 |
Benzoic acid, 3-hydroxy-, 2'-ester with 6-((3-O-acetyl-beta-D-glucopyranosyl)oxy)-5-ethenyl-4,4a,5,6-tetrahydro-1H,3H-pyrano(3,4-c)pyran-1-one, (4aS-(4aalpha,5beta,6alpha))- |
DTXSID60207932 |
![2D Structure of Centapicrin 2D Structure of Centapicrin](https://plantaedb.com/storage/docs/compounds/2023/11/centapicrin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.32% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.24% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.22% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.63% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.57% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.56% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.33% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.75% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.01% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.72% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.72% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.00% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.90% | 93.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.46% | 96.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.29% | 89.67% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.05% | 87.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.52% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.38% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.61% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centaurium erythraea |
PubChem | 6453770 |
LOTUS | LTS0116219 |
wikiData | Q83081951 |