(1S,3S,9R,11S)-7-(3,4-dihydroxybenzoyl)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10,10-tetramethyl-3,9-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione
| Internal ID | 12d52bd8-01b4-463d-b8d9-df74815c3963 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1S,3S,9R,11S)-7-(3,4-dihydroxybenzoyl)-11-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,4,10,10-tetramethyl-3,9-bis(3-methylbut-2-enyl)-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
| SMILES (Canonical) | CC(=CCCC(=CCC1CC23CC(C(OC2=C(C(=O)C(C3=O)(C1(C)C)CC=C(C)C)C(=O)C4=CC(=C(C=C4)O)O)(C)C)CC=C(C)C)C)C |
| SMILES (Isomeric) | CC(=CCC/C(=C/C[C@H]1C[C@]23C[C@@H](C(OC2=C(C(=O)[C@@](C3=O)(C1(C)C)CC=C(C)C)C(=O)C4=CC(=C(C=C4)O)O)(C)C)CC=C(C)C)/C)C |
| InChI | InChI=1S/C43H58O6/c1-26(2)13-12-14-29(7)16-19-31-24-42-25-32(18-15-27(3)4)41(10,11)49-38(42)35(36(46)30-17-20-33(44)34(45)23-30)37(47)43(39(42)48,40(31,8)9)22-21-28(5)6/h13,15-17,20-21,23,31-32,44-45H,12,14,18-19,22,24-25H2,1-11H3/b29-16+/t31-,32-,42-,43-/m0/s1 |
| InChI Key | BLQOYAAVGHQNPQ-JGDCDEKGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C43H58O6 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.42333957 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 10.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.95% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.50% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.19% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.87% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.80% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.06% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.42% | 91.07% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.34% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.39% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.84% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.37% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.24% | 99.17% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.09% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.45% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.02% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.62% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.97% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.67% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.39% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.13% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Symphonia globulifera |
| PubChem | 46849196 |
| LOTUS | LTS0077810 |
| wikiData | Q104938103 |