(6S,8R,11R,12S,13R,15R,16R)-13-hydroxy-15-[(2R)-6-hydroxy-6-methyl-4-oxoheptan-2-yl]-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxytetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one
| Internal ID | 46d52233-2559-4a99-aae2-8b682518bcc9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (6S,8R,11R,12S,13R,15R,16R)-13-hydroxy-15-[(2R)-6-hydroxy-6-methyl-4-oxoheptan-2-yl]-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxytetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one |
| SMILES (Canonical) | CC(CC(=O)CC(C)(C)O)C1C(=O)C(C2(C1(CC=C3C2CCC4C(=C3)CCC(C4(C)C)OC5C(C(C(CO5)O)O)O)C)C)O |
| SMILES (Isomeric) | C[C@H](CC(=O)CC(C)(C)O)[C@H]1C(=O)[C@@H]([C@@]2([C@@]1(CC=C3[C@H]2CC[C@@H]4C(=C3)CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)C)C)O |
| InChI | InChI=1S/C35H54O9/c1-18(14-21(36)16-32(2,3)42)26-28(39)30(41)35(7)23-10-9-22-19(15-20(23)12-13-34(26,35)6)8-11-25(33(22,4)5)44-31-29(40)27(38)24(37)17-43-31/h12,15,18,22-27,29-31,37-38,40-42H,8-11,13-14,16-17H2,1-7H3/t18-,22-,23-,24+,25+,26+,27+,29-,30+,31+,34-,35-/m1/s1 |
| InChI Key | XJWAIEFSYQNENI-JFFLNHBPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H54O9 |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.37678330 g/mol |
| Topological Polar Surface Area (TPSA) | 154.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.80% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.40% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.25% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.19% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.38% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.69% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.53% | 95.89% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.24% | 97.28% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.40% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.88% | 94.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.80% | 91.07% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.12% | 90.93% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.12% | 97.79% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.98% | 85.31% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.27% | 97.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.20% | 92.62% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.90% | 89.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.32% | 92.50% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.79% | 92.78% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.77% | 90.24% |
| CHEMBL5028 | O14672 | ADAM10 | 81.26% | 97.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.15% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.03% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea podocarpa |
| PubChem | 16110017 |
| LOTUS | LTS0076450 |
| wikiData | Q105329264 |