(5Z)-5-[(1S,4S,5R,6S,8R,9S)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one
| Internal ID | 39794258-fbe7-4d27-8656-220dca9090bd |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Aminosaccharides > Aminoglycosides |
| IUPAC Name | (5Z)-5-[(1S,4S,5R,6S,8R,9S)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES (Canonical) | CCCCC12C3CCN1C4CC2OC35C4C(C(=C6C(=C(C(=O)O6)C)OC)O5)C |
| SMILES (Isomeric) | CCCC[C@]12[C@H]3C[C@@H]4N1CCC2[C@@]5([C@@H]4[C@@H](/C(=C/6\C(=C(C(=O)O6)C)OC)/O5)C)O3 |
| InChI | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18-/t11-,13-,14?,15+,16+,21-,22+/m0/s1 |
| InChI Key | DTVYAHOULQCSMS-JQANZLKUSA-N |
| Popularity | 24 references in papers |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.20457303 g/mol |
| Topological Polar Surface Area (TPSA) | 57.20 Ų |
| XlogP | 2.90 |
| CHEMBL2304257 |
| BDBM50376056 |
![2D Structure of (5Z)-5-[(1S,4S,5R,6S,8R,9S)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one](https://plantaedb.com/storage/docs/compounds/2023/07/ce682e30-2523-11ee-a446-db6f97fa1156.jpg "2D Structure of (5Z)-5-[(1S,4S,5R,6S,8R,9S)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.78% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.61% | 96.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 94.53% | 94.66% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.99% | 96.61% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.99% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.46% | 97.09% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.69% | 82.38% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.46% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.24% | 97.14% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.89% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.64% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.92% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.42% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.51% | 90.17% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.50% | 96.43% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.36% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.29% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.44% | 94.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.93% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.83% | 92.94% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.03% | 93.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 80.68% | 94.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.32% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stemona aphylla |
| Stemona japonica |
| PubChem | 44448167 |
| NPASS | NPC138534 |
| ChEMBL | CHEMBL2304257 |
| LOTUS | LTS0043302 |
| wikiData | Q104989046 |