[(1S,4aS,6S,7R,7aS)-7-(acetyloxymethyl)-4-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxymethyl]-6,7-dihydroxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate
Internal ID | fb740a94-8ee5-4e04-a686-496498d88ef3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,6S,7R,7aS)-7-(acetyloxymethyl)-4-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxymethyl]-6,7-dihydroxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC1C2C(CC(C2(COC(=O)C)O)O)C(=CO1)COC3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=C(C=C4)O |
SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1[C@H]2[C@H](C[C@@H]([C@@]2(COC(=O)C)O)O)C(=CO1)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)OC(=O)/C=C\C4=CC=C(C=C4)O |
InChI | InChI=1S/C32H42O15/c1-16(2)10-25(38)47-30-26-21(11-23(36)32(26,41)15-44-17(3)34)19(13-42-30)14-43-31-29(28(40)27(39)22(12-33)45-31)46-24(37)9-6-18-4-7-20(35)8-5-18/h4-9,13,16,21-23,26-31,33,35-36,39-41H,10-12,14-15H2,1-3H3/b9-6-/t21-,22-,23+,26-,27-,28+,29-,30+,31-,32-/m1/s1 |
InChI Key | AAALJWLFINEDCQ-DLCWQLDFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O15 |
Molecular Weight | 666.70 g/mol |
Exact Mass | 666.25237063 g/mol |
Topological Polar Surface Area (TPSA) | 228.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of [(1S,4aS,6S,7R,7aS)-7-(acetyloxymethyl)-4-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxymethyl]-6,7-dihydroxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate 2D Structure of [(1S,4aS,6S,7R,7aS)-7-(acetyloxymethyl)-4-[[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxymethyl]-6,7-dihydroxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/cd513190-866e-11ee-8311-71d4012a0b61.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.22% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.16% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.02% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.81% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.70% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.66% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.65% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.22% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.13% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.10% | 94.45% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 91.34% | 97.64% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 89.33% | 98.35% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.33% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.61% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.85% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.57% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.29% | 99.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.25% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.25% | 94.62% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.73% | 85.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.43% | 94.73% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 83.04% | 94.97% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.44% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.81% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.52% | 89.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.43% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.35% | 95.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.26% | 96.95% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.21% | 94.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.09% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum ayavacense |
Viburnum tinus |
PubChem | 101915806 |
LOTUS | LTS0176624 |
wikiData | Q104666917 |