(3S,5R,9R,10S,13R,14R,17R)-17-[(2S,3E,5S)-5-ethyl-6-methylhepta-3,6-dien-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | d5159713-62b5-4186-894e-39f92def2e14 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (3S,5R,9R,10S,13R,14R,17R)-17-[(2S,3E,5S)-5-ethyl-6-methylhepta-3,6-dien-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C)C)C(=C)C |
SMILES (Isomeric) | CC[C@@H](/C=C/[C@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC[C@H]4[C@@]3(CC[C@@H](C4)O)C)C)C(=C)C |
InChI | InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,20-23,25-27,30H,2,7,10,12-18H2,1,3-6H3/b9-8+/t20-,21-,22+,23-,25+,26-,27-,28-,29+/m0/s1 |
InChI Key | IMWBKGMKWXIXEQ-NLHLVYEFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H46O |
Molecular Weight | 410.70 g/mol |
Exact Mass | 410.354866087 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.85% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.74% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.59% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.36% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.25% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.48% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.13% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.82% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.49% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.45% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.28% | 95.89% |
CHEMBL1977 | P11473 | Vitamin D receptor | 88.29% | 99.43% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 86.84% | 88.81% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.53% | 92.86% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.79% | 100.00% |
CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 84.76% | 81.88% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.90% | 97.21% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.82% | 94.75% |
CHEMBL240 | Q12809 | HERG | 83.58% | 89.76% |
CHEMBL2581 | P07339 | Cathepsin D | 81.83% | 98.95% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.45% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cucurbita pepo |
Vinca erecta |
PubChem | 163007760 |
LOTUS | LTS0204001 |
wikiData | Q105224142 |