N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide
Internal ID | 98b056c9-c857-4111-b7fb-30e6435459fa |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
IUPAC Name | N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide |
SMILES (Canonical) | CCCCCC(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CC(CC2C(=O)NC(CCCN=C(N)N)C=O)C |
SMILES (Isomeric) | CCCCCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N2CC(CC2C(=O)NC(CCCN=C(N)N)C=O)C |
InChI | InChI=1S/C27H42N6O5/c1-3-4-5-8-24(36)32-22(15-19-9-11-21(35)12-10-19)26(38)33-16-18(2)14-23(33)25(37)31-20(17-34)7-6-13-30-27(28)29/h9-12,17-18,20,22-23,35H,3-8,13-16H2,1-2H3,(H,31,37)(H,32,36)(H4,28,29,30)/t18?,20?,22-,23?/m0/s1 |
InChI Key | ULFMNSXBTYDMFI-UGWHRVMUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H42N6O5 |
Molecular Weight | 530.70 g/mol |
Exact Mass | 530.32166846 g/mol |
Topological Polar Surface Area (TPSA) | 180.00 Ų |
XlogP | 1.70 |
Atomic LogP (AlogP) | 0.97 |
H-Bond Acceptor | 6 |
H-Bond Donor | 5 |
Rotatable Bonds | 15 |
There are no found synonyms. |
![2D Structure of N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide 2D Structure of N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(hexanoylamino)-3-(4-hydroxyphenyl)propanoyl]-4-methylpyrrolidine-2-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/cc9f6570-8608-11ee-958b-d36c3b045562.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9576 | 95.76% |
Caco-2 | - | 0.8626 | 86.26% |
Blood Brain Barrier | + | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.5670 | 56.70% |
OATP2B1 inhibitior | - | 0.5795 | 57.95% |
OATP1B1 inhibitior | + | 0.8576 | 85.76% |
OATP1B3 inhibitior | + | 0.9350 | 93.50% |
MATE1 inhibitior | - | 0.6400 | 64.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.8637 | 86.37% |
P-glycoprotein inhibitior | + | 0.7345 | 73.45% |
P-glycoprotein substrate | + | 0.8678 | 86.78% |
CYP3A4 substrate | + | 0.6774 | 67.74% |
CYP2C9 substrate | - | 0.5918 | 59.18% |
CYP2D6 substrate | - | 0.8024 | 80.24% |
CYP3A4 inhibition | - | 0.8732 | 87.32% |
CYP2C9 inhibition | - | 0.8297 | 82.97% |
CYP2C19 inhibition | - | 0.7644 | 76.44% |
CYP2D6 inhibition | - | 0.8986 | 89.86% |
CYP1A2 inhibition | - | 0.8931 | 89.31% |
CYP2C8 inhibition | + | 0.5828 | 58.28% |
CYP inhibitory promiscuity | - | 0.9577 | 95.77% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.8600 | 86.00% |
Carcinogenicity (trinary) | Non-required | 0.6276 | 62.76% |
Eye corrosion | - | 0.9893 | 98.93% |
Eye irritation | - | 0.9647 | 96.47% |
Skin irritation | - | 0.7723 | 77.23% |
Skin corrosion | - | 0.9189 | 91.89% |
Ames mutagenesis | - | 0.7200 | 72.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4831 | 48.31% |
Micronuclear | + | 0.8000 | 80.00% |
Hepatotoxicity | + | 0.5198 | 51.98% |
skin sensitisation | - | 0.8731 | 87.31% |
Respiratory toxicity | + | 0.5889 | 58.89% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.7375 | 73.75% |
Nephrotoxicity | - | 0.5835 | 58.35% |
Acute Oral Toxicity (c) | III | 0.6617 | 66.17% |
Estrogen receptor binding | + | 0.5795 | 57.95% |
Androgen receptor binding | + | 0.6160 | 61.60% |
Thyroid receptor binding | + | 0.5373 | 53.73% |
Glucocorticoid receptor binding | + | 0.6337 | 63.37% |
Aromatase binding | + | 0.5802 | 58.02% |
PPAR gamma | + | 0.6102 | 61.02% |
Honey bee toxicity | - | 0.8507 | 85.07% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.6610 | 66.10% |
Fish aquatic toxicity | + | 0.8661 | 86.61% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.65% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.98% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.53% | 96.09% |
CHEMBL3837 | P07711 | Cathepsin L | 98.11% | 96.61% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.60% | 90.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.04% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.04% | 94.45% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.57% | 91.81% |
CHEMBL4072 | P07858 | Cathepsin B | 93.98% | 93.67% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.29% | 93.10% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.20% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.91% | 82.69% |
CHEMBL3891 | P07384 | Calpain 1 | 92.86% | 93.04% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.41% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.14% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.07% | 97.09% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.99% | 97.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.12% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 89.71% | 98.75% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.62% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.18% | 91.19% |
CHEMBL2431 | P31751 | Serine/threonine-protein kinase AKT2 | 89.17% | 98.33% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.91% | 90.24% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.93% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.57% | 100.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.64% | 89.63% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.39% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.30% | 93.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 85.88% | 90.20% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.67% | 98.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.21% | 95.89% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.15% | 96.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.09% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.35% | 93.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.86% | 97.64% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.17% | 90.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.64% | 92.86% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.43% | 95.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.24% | 97.29% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.93% | 95.38% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.34% | 96.95% |
CHEMBL4644 | P41968 | Melanocortin receptor 3 | 80.81% | 99.52% |
CHEMBL4608 | P33032 | Melanocortin receptor 5 | 80.08% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fragaria × ananassa |
PubChem | 163194732 |
LOTUS | LTS0180116 |
wikiData | Q105155324 |