5-Hydroxy-2-methyl-9-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxymethyl]-8,11-dihydropyrano[2,3-g][1]benzoxepin-4-one
Internal ID | b3f85c6f-2c7b-4e06-a540-964027446a12 |
Taxonomy | Organoheterocyclic compounds > Benzoxepines |
IUPAC Name | 5-hydroxy-2-methyl-9-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]-8,11-dihydropyrano[2,3-g][1]benzoxepin-4-one |
SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C3=C(C=C2O)OCC(=CC3)COC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C3=C(C=C2O)OCC(=CC3)COC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)O)O |
InChI | InChI=1S/C27H34O15/c1-10-4-13(29)18-14(30)5-15-12(25(18)40-10)3-2-11(7-37-15)8-38-26-24(36)22(34)20(32)17(42-26)9-39-27-23(35)21(33)19(31)16(6-28)41-27/h2,4-5,16-17,19-24,26-28,30-36H,3,6-9H2,1H3 |
InChI Key | HJOAQEYWNOPRHE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O15 |
Molecular Weight | 598.50 g/mol |
Exact Mass | 598.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -2.30 |
CHEMBL1979804 |
NSC-650386 |
NCI60_017547 |
(5-Hydroxy-2-methyl-4-oxo-8,11-dihydro-4H-oxepino[2,3-h]chromen-9-yl)methyl 6-O-hexopyranosylhexopyranoside |
5-hydroxy-2-methyl-9-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]tetrahydropyran-2-yl]oxymethyl]-8,11-dihydropyrano[2,3-g][1]benzoxepin-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.29% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.02% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.24% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.36% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.32% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.30% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.16% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.98% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.81% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.48% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.14% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.33% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eranthis cilicica |
Eranthis hyemalis |
PubChem | 373656 |
LOTUS | LTS0117748 |
wikiData | Q105029358 |