[(1S,2S,6S,9S,10S,11R,12S,13S,14S,15S,16S,17R,18R,19S,22S,23S,25R)-10,12,14,16,17,23-hexahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate
Internal ID | 476970ef-e166-4076-bf07-a9603331c38c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15S,16S,17R,18R,19S,22S,23S,25R)-10,12,14,16,17,23-hexahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(C(C6C7(C5(C4)OC6(C(CC7)OC(=O)C(C)(CC)O)O)C)O)O)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H]([C@@H]([C@H]6[C@]7([C@]5(C4)O[C@@]6([C@H](CC7)OC(=O)[C@](C)(CC)O)O)C)O)O)O)O |
InChI | InChI=1S/C37H59NO12/c1-8-18(4)30(42)49-29-24(39)23-19(16-38-15-17(3)10-11-21(38)34(23,7)45)20-14-35-28(36(20,29)46)26(41)25(40)27-32(35,5)13-12-22(37(27,47)50-35)48-31(43)33(6,44)9-2/h17-29,39-41,44-47H,8-16H2,1-7H3/t17-,18+,19-,20-,21-,22-,23+,24-,25-,26+,27-,28+,29-,32-,33-,34+,35+,36-,37+/m0/s1 |
InChI Key | ZAYNFRRRRZOVDM-KMCBUUMWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H59NO12 |
Molecular Weight | 709.90 g/mol |
Exact Mass | 709.40372632 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | 1.00 |
Atomic LogP (AlogP) | 0.47 |
H-Bond Acceptor | 13 |
H-Bond Donor | 7 |
Rotatable Bonds | 6 |
There are no found synonyms. |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15S,16S,17R,18R,19S,22S,23S,25R)-10,12,14,16,17,23-hexahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12S,13S,14S,15S,16S,17R,18R,19S,22S,23S,25R)-10,12,14,16,17,23-hexahydroxy-6,10,19-trimethyl-13-[(2R)-2-methylbutanoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-22-yl] (2S)-2-hydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/cc6577f0-84d6-11ee-b55e-f3845cfc3931.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5064 | 50.64% |
Caco-2 | - | 0.8542 | 85.42% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.6286 | 62.86% |
Subcellular localzation | Lysosomes | 0.6135 | 61.35% |
OATP2B1 inhibitior | - | 0.7276 | 72.76% |
OATP1B1 inhibitior | + | 0.9266 | 92.66% |
OATP1B3 inhibitior | + | 0.9483 | 94.83% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.7250 | 72.50% |
BSEP inhibitior | - | 0.6321 | 63.21% |
P-glycoprotein inhibitior | + | 0.7307 | 73.07% |
P-glycoprotein substrate | + | 0.6730 | 67.30% |
CYP3A4 substrate | + | 0.7404 | 74.04% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8018 | 80.18% |
CYP3A4 inhibition | - | 0.8431 | 84.31% |
CYP2C9 inhibition | - | 0.9083 | 90.83% |
CYP2C19 inhibition | - | 0.9129 | 91.29% |
CYP2D6 inhibition | - | 0.9348 | 93.48% |
CYP1A2 inhibition | - | 0.9395 | 93.95% |
CYP2C8 inhibition | + | 0.7170 | 71.70% |
CYP inhibitory promiscuity | - | 0.9785 | 97.85% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5182 | 51.82% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.9179 | 91.79% |
Skin irritation | - | 0.7554 | 75.54% |
Skin corrosion | - | 0.9324 | 93.24% |
Ames mutagenesis | - | 0.5911 | 59.11% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4217 | 42.17% |
Micronuclear | + | 0.6000 | 60.00% |
Hepatotoxicity | + | 0.5666 | 56.66% |
skin sensitisation | - | 0.8778 | 87.78% |
Respiratory toxicity | + | 0.6778 | 67.78% |
Reproductive toxicity | + | 0.8889 | 88.89% |
Mitochondrial toxicity | + | 0.9625 | 96.25% |
Nephrotoxicity | + | 0.4750 | 47.50% |
Acute Oral Toxicity (c) | I | 0.7603 | 76.03% |
Estrogen receptor binding | + | 0.6709 | 67.09% |
Androgen receptor binding | + | 0.7608 | 76.08% |
Thyroid receptor binding | - | 0.5911 | 59.11% |
Glucocorticoid receptor binding | + | 0.6479 | 64.79% |
Aromatase binding | + | 0.6586 | 65.86% |
PPAR gamma | + | 0.6879 | 68.79% |
Honey bee toxicity | - | 0.7025 | 70.25% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
Fish aquatic toxicity | + | 0.7532 | 75.32% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.96% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 97.67% | 89.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.05% | 96.77% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 95.58% | 95.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.17% | 96.47% |
CHEMBL2581 | P07339 | Cathepsin D | 93.94% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.86% | 97.14% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 91.18% | 100.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.59% | 95.36% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.04% | 85.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.48% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.30% | 86.33% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.09% | 98.03% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.13% | 82.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.11% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.85% | 96.61% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.73% | 93.56% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.03% | 91.03% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.83% | 97.28% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.73% | 94.78% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 86.64% | 87.16% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.30% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.04% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.94% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.66% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.59% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.22% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.86% | 96.90% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.69% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.63% | 98.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.31% | 94.45% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.15% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.67% | 89.50% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.32% | 95.71% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.91% | 99.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.84% | 89.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.80% | 97.50% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.69% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.46% | 90.71% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.05% | 82.69% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.84% | 95.71% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.83% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.60% | 99.23% |
CHEMBL4072 | P07858 | Cathepsin B | 80.22% | 93.67% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.08% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum nigrum |
PubChem | 162985159 |
LOTUS | LTS0175679 |
wikiData | Q105370350 |