2-[3-Hydroxy-2-(hydroxymethyl)-6-(10-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 676df7c8-e379-45e5-8d4c-681d6df33f92 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[3-hydroxy-2-(hydroxymethyl)-6-(10-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(C(CC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)O)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(C(CC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)O)C)C)OC1 |
InChI | InChI=1S/C45H74O19/c1-18-7-10-45(57-17-18)19(2)30-25(64-45)12-24-22-6-5-20-11-21(8-9-43(20,3)23(22)13-29(49)44(24,30)4)58-42-39(63-41-37(56)35(54)32(51)27(15-47)60-41)38(33(52)28(16-48)61-42)62-40-36(55)34(53)31(50)26(14-46)59-40/h18-42,46-56H,5-17H2,1-4H3 |
InChI Key | IQHXARVDUZKXAP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H74O19 |
Molecular Weight | 919.10 g/mol |
Exact Mass | 918.48243013 g/mol |
Topological Polar Surface Area (TPSA) | 296.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.79% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.63% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.89% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.61% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.08% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.26% | 89.05% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.84% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.44% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.50% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.26% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.22% | 97.25% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.19% | 97.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.15% | 92.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.38% | 95.93% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.36% | 96.77% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.81% | 92.86% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.63% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.51% | 91.24% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 85.43% | 97.31% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.39% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.44% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.32% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.75% | 100.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.60% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.64% | 86.33% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 80.62% | 97.64% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.13% | 95.58% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.11% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Yucca gloriosa |
PubChem | 162878952 |
LOTUS | LTS0120978 |
wikiData | Q105117840 |