[(2R,3R,4R,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | be843564-d921-46af-874e-4d40db7d0a32 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2R,3R,4R,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C28H34O15/c29-11-20-25(42-21(35)6-3-13-1-4-15(30)17(32)9-13)26(43-27-23(37)22(36)19(34)12-40-27)24(38)28(41-20)39-8-7-14-2-5-16(31)18(33)10-14/h1-6,9-10,19-20,22-34,36-38H,7-8,11-12H2/b6-3+/t19-,20-,22+,23-,24-,25-,26-,27+,28-/m1/s1 |
InChI Key | IIVINXPOHZUXQM-TYGLCWKWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O15 |
Molecular Weight | 610.60 g/mol |
Exact Mass | 610.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4R,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3R,4R,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/cb7089f0-833e-11ee-b825-73be45beca3e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.86% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.55% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.73% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.25% | 86.92% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.98% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 92.50% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.13% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.86% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.59% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.51% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.92% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.37% | 98.95% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.83% | 96.37% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.96% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.36% | 95.93% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.50% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.45% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.85% | 80.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.57% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gesneria pedicellaris |
Meehania urticifolia |
Polypremum procumbens |
Strobilanthes cusia |
PubChem | 11192794 |
LOTUS | LTS0253258 |
wikiData | Q105352699 |