Capsicoside C
Internal ID | 78a47342-decd-4944-89b3-cb612fea238d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-[16-[5-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-hydroxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC |
InChI | InChI=1S/C52H88O25/c1-20(19-69-46-41(65)37(61)34(58)29(15-53)71-46)8-11-52(68-5)21(2)33-28(77-52)13-25-23-7-6-22-12-27(26(57)14-51(22,4)24(23)9-10-50(25,33)3)70-47-43(67)40(64)44(32(18-56)74-47)75-49-45(39(63)36(60)31(17-55)73-49)76-48-42(66)38(62)35(59)30(16-54)72-48/h20-49,53-67H,6-19H2,1-5H3 |
InChI Key | CKNKYVMVZPUAOQ-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C52H88O25 |
Molecular Weight | 1113.20 g/mol |
Exact Mass | 1112.56146829 g/mol |
Topological Polar Surface Area (TPSA) | 396.00 Ų |
XlogP | -1.90 |
CHEBI:192888 |
DTXSID401317791 |
160219-66-9 |
2-[4-[16-[5-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-hydroxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.79% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.75% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.36% | 96.21% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.54% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.43% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 93.35% | 98.10% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.29% | 92.86% |
CHEMBL204 | P00734 | Thrombin | 92.77% | 96.01% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.47% | 95.93% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.74% | 98.05% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 90.80% | 92.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.76% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.61% | 93.18% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.60% | 92.98% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.42% | 97.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.55% | 94.45% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.93% | 95.36% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.43% | 97.29% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.87% | 97.25% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.84% | 95.58% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.51% | 89.05% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.50% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.82% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.71% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.34% | 96.43% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.77% | 97.86% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.27% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.71% | 95.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.65% | 96.38% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.95% | 97.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.59% | 92.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.41% | 95.38% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.11% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.03% | 93.56% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.80% | 91.03% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.59% | 99.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.46% | 96.47% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.35% | 98.46% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Agave utahensis |
Capsicum annuum |
PubChem | 75225104 |
LOTUS | LTS0028725 |
wikiData | Q104962559 |