Capparidisine
Internal ID | ba480145-9cfe-4f37-845d-8a1f6f277469 |
Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
IUPAC Name | (8E,22E)-4-hydroxy-25,26-dimethoxy-2-oxa-11,15,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3,5,7(29),8,22,24,27-octaene-10,21-dione |
SMILES (Canonical) | COC1=C2C=CC(=C1OC)OC3=C(C=CC(=C3)C=CC(=O)NCCCNCCCCNC(=O)C=C2)O |
SMILES (Isomeric) | COC1=C\2C=CC(=C1OC)OC3=C(C=CC(=C3)/C=C/C(=O)NCCCNCCCCNC(=O)/C=C2)O |
InChI | InChI=1S/C27H33N3O6/c1-34-26-20-8-11-22(27(26)35-2)36-23-18-19(6-10-21(23)31)7-12-24(32)30-17-5-15-28-14-3-4-16-29-25(33)13-9-20/h6-13,18,28,31H,3-5,14-17H2,1-2H3,(H,29,33)(H,30,32)/b12-7+,13-9+ |
InChI Key | VLJFIIWEERHAMV-QYFNTBEASA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H33N3O6 |
Molecular Weight | 495.60 g/mol |
Exact Mass | 495.23693578 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 3.00 |
Capparidisine |
Capparadisine |
NSC-610735 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.10% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.01% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.21% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.80% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.78% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.58% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.10% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.99% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.47% | 91.49% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.24% | 80.78% |
CHEMBL2535 | P11166 | Glucose transporter | 84.88% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.37% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.54% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capparis decidua |
PubChem | 5386445 |
LOTUS | LTS0137081 |
wikiData | Q105288439 |