Campesenin
Internal ID | bae8564b-c0ee-4e08-adab-5c151283c282 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Coumarin glycosides |
IUPAC Name | 2-(2-hydroxypropan-2-yl)-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
SMILES (Canonical) | CC(C)(C1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | CC(C)(C1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C20H24O10/c1-20(2,26)11-6-9-5-8-3-4-12(22)29-16(8)18(17(9)28-11)30-19-15(25)14(24)13(23)10(7-21)27-19/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3 |
InChI Key | JWWFVRMFYKPZNE-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H24O10 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -0.20 |
Campesenin |
AKOS040753870 |
HY-121770 |
CS-0083269 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.35% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.34% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.97% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.96% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.16% | 95.56% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.46% | 94.45% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.24% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.87% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.41% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.05% | 86.33% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.13% | 89.34% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.70% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.36% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.33% | 90.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.61% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruta graveolens |
PubChem | 5131188 |
LOTUS | LTS0145184 |
wikiData | Q105136414 |